C11H19N3O2S — CID 3235601
N-cyclopentyl-1,3,5-trimethylpyrazole-4-sulfonamide (PubChem CID 3235601) has the molecular formula C11H19N3O2S and a molecular weight of 257.36 g/mol. Its IUPAC name is N-cyclopentyl-1,3,5-trimethylpyrazole-4-sulfonamide.
| Compound Name | N-cyclopentyl-1,3,5-trimethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 3235601 |
| Molecular Formula | C11H19N3O2S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | N-cyclopentyl-1,3,5-trimethylpyrazole-4-sulfonamide |
| SMILES | Cc1nn(C)c(C)c1S(=O)(=O)NC1CCCC1 |
| InChI | InChI=1S/C11H19N3O2S/c1-8-11(9(2)14(3)12-8)17(15,16)13-10-6-4-5-7-10/h10,13H,4-7H2,1-3H3 |
| InChIKey | JZMKTSXUJMXXTG-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |