About N-[4,5-dimethyl-3-[morpholin-4-yl(pyridin-4-yl)methyl]thiophen-2-yl]furan-2-carboxamide
N-[4,5-dimethyl-3-[morpholin-4-yl(pyridin-4-yl)methyl]thiophen-2-yl]furan-2-carboxamide (PubChem CID 3235695) has the molecular formula C21H23N3O3S
and a molecular weight of 397.50 g/mol. Its IUPAC name is N-[4,5-dimethyl-3-[morpholin-4-yl(pyridin-4-yl)methyl]thiophen-2-yl]furan-2-carboxamide.
Molecular Properties
| Compound Name | N-[4,5-dimethyl-3-[morpholin-4-yl(pyridin-4-yl)methyl]thiophen-2-yl]furan-2-carboxamide |
| PubChem CID | 3235695 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | N-[4,5-dimethyl-3-[morpholin-4-yl(pyridin-4-yl)methyl]thiophen-2-yl]furan-2-carboxamide |
| SMILES | Cc1sc(NC(=O)c2ccco2)c(C(c2ccncc2)N2CCOCC2)c1C |
| InChI | InChI=1S/C21H23N3O3S/c1-14-15(2)28-21(23-20(25)17-4-3-11-27-17)18(14)19(16-5-7-22-8-6-16)24-9-12-26-13-10-24/h3-8,11,19H,9-10,12-13H2,1-2H3,(H,23,25) |
| InChIKey | YAOMJGCWLVWMNH-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[4,5-dimethyl-3-[morpholin-4-yl(pyridin-4-yl)methyl]thiophen-2-yl]furan-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4,5-dimethyl-3-[morpholin-4-yl(pyridin-4-yl)methyl]thiophen-2-yl]furan-2-carboxamide?
The IUPAC name of N-[4,5-dimethyl-3-[morpholin-4-yl(pyridin-4-yl)methyl]thiophen-2-yl]furan-2-carboxamide (CID 3235695) is N-[4,5-dimethyl-3-[morpholin-4-yl(pyridin-4-yl)methyl]thiophen-2-yl]furan-2-carboxamide.
What is the SMILES notation for N-[4,5-dimethyl-3-[morpholin-4-yl(pyridin-4-yl)methyl]thiophen-2-yl]furan-2-carboxamide?
The canonical SMILES for N-[4,5-dimethyl-3-[morpholin-4-yl(pyridin-4-yl)methyl]thiophen-2-yl]furan-2-carboxamide is Cc1sc(NC(=O)c2ccco2)c(C(c2ccncc2)N2CCOCC2)c1C.
What is the InChIKey of N-[4,5-dimethyl-3-[morpholin-4-yl(pyridin-4-yl)methyl]thiophen-2-yl]furan-2-carboxamide?
The InChIKey is YAOMJGCWLVWMNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N3O3S/c1-14-15(2)28-21(23-20(25)17-4-3-11-27-17)18(14)19(16-5-7-22-8-6-16)24-9-12-26-13-10-24/h3-8,11,19H,9-10,12-13H2,1-2H3,(H,23,25).
What are the key properties of N-[4,5-dimethyl-3-[morpholin-4-yl(pyridin-4-yl)methyl]thiophen-2-yl]furan-2-carboxamide?
N-[4,5-dimethyl-3-[morpholin-4-yl(pyridin-4-yl)methyl]thiophen-2-yl]furan-2-carboxamide has a molecular weight of 397.50 g/mol, XLogP of 4.03, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4,5-dimethyl-3-[morpholin-4-yl(pyridin-4-yl)methyl]thiophen-2-yl]furan-2-carboxamide is sourced from PubChem (CID 3235695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).