C11H14ClN3O4S — CID 3235709
N,N,2-trimethyl-3-phenyl-1,2,4-thiadiazol-2-ium-5-amine perchlorate (PubChem CID 3235709) has the molecular formula C11H14ClN3O4S and a molecular weight of 319.77 g/mol. Its IUPAC name is N,N,2-trimethyl-3-phenyl-1,2,4-thiadiazol-2-ium-5-amine perchlorate.
| Compound Name | N,N,2-trimethyl-3-phenyl-1,2,4-thiadiazol-2-ium-5-amine perchlorate |
|---|---|
| PubChem CID | 3235709 |
| Molecular Formula | C11H14ClN3O4S |
| Molecular Weight | 319.77 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | N,N,2-trimethyl-3-phenyl-1,2,4-thiadiazol-2-ium-5-amine perchlorate |
| SMILES | CN(C)c1nc(-c2ccccc2)[n+](C)s1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C11H14N3S.ClHO4/c1-13(2)11-12-10(14(3)15-11)9-7-5-4-6-8-9;2-1(3,4)5/h4-8H,1-3H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | YQGBAIVVBRFNEX-UHFFFAOYSA-M |
| XLogP | -3.06 |
| TPSA | 112.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.77 |
| LogP ≤ 5 | -3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|