About 5,7-dimethyltetrazolo[1,5-a]pyridine-8-carbonitrile
5,7-dimethyltetrazolo[1,5-a]pyridine-8-carbonitrile (PubChem CID 3235750) has the molecular formula C8H7N5
and a molecular weight of 173.18 g/mol. Its IUPAC name is 5,7-dimethyltetrazolo[1,5-a]pyridine-8-carbonitrile.
Molecular Properties
| Compound Name | 5,7-dimethyltetrazolo[1,5-a]pyridine-8-carbonitrile |
| PubChem CID | 3235750 |
| Molecular Formula | C8H7N5 |
| Molecular Weight | 173.18 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | 5,7-dimethyltetrazolo[1,5-a]pyridine-8-carbonitrile |
| SMILES | Cc1cc(C)n2nnnc2c1C#N |
| InChI | InChI=1S/C8H7N5/c1-5-3-6(2)13-8(7(5)4-9)10-11-12-13/h3H,1-2H3 |
| InChIKey | OAXIKPHHQBZTRO-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 66.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.18 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5,7-dimethyltetrazolo[1,5-a]pyridine-8-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dimethyltetrazolo[1,5-a]pyridine-8-carbonitrile?
The IUPAC name of 5,7-dimethyltetrazolo[1,5-a]pyridine-8-carbonitrile (CID 3235750) is 5,7-dimethyltetrazolo[1,5-a]pyridine-8-carbonitrile.
What is the SMILES notation for 5,7-dimethyltetrazolo[1,5-a]pyridine-8-carbonitrile?
The canonical SMILES for 5,7-dimethyltetrazolo[1,5-a]pyridine-8-carbonitrile is Cc1cc(C)n2nnnc2c1C#N.
What is the InChIKey of 5,7-dimethyltetrazolo[1,5-a]pyridine-8-carbonitrile?
The InChIKey is OAXIKPHHQBZTRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N5/c1-5-3-6(2)13-8(7(5)4-9)10-11-12-13/h3H,1-2H3.
What are the key properties of 5,7-dimethyltetrazolo[1,5-a]pyridine-8-carbonitrile?
5,7-dimethyltetrazolo[1,5-a]pyridine-8-carbonitrile has a molecular weight of 173.18 g/mol, XLogP of 0.61, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dimethyltetrazolo[1,5-a]pyridine-8-carbonitrile is sourced from PubChem (CID 3235750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).