C22H24N2O3 — CID 3235764
3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-(1,2,3,4-tetrahydronaphthalen-1-yl)propanamide (PubChem CID 3235764) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is 3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-(1,2,3,4-tetrahydronaphthalen-1-yl)propanamide.
| Compound Name | 3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-(1,2,3,4-tetrahydronaphthalen-1-yl)propanamide |
|---|---|
| PubChem CID | 3235764 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-(1,2,3,4-tetrahydronaphthalen-1-yl)propanamide |
| SMILES | O=C(CCN1C(=O)C2C3C=CC(C3)C2C1=O)NC1CCCc2ccccc21 |
| InChI | InChI=1S/C22H24N2O3/c25-18(23-17-7-3-5-13-4-1-2-6-16(13)17)10-11-24-21(26)19-14-8-9-15(12-14)20(19)22(24)27/h1-2,4,6,8-9,14-15,17,19-20H,3,5,7,10-12H2,(H,23,25) |
| InChIKey | LUYDYUNUZBCJEW-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|