About 1-(4-ethylthieno[3,2-b]pyrrole-5-carbonyl)-N-(3-phenylpropyl)piperidine-3-carboxamide
1-(4-ethylthieno[3,2-b]pyrrole-5-carbonyl)-N-(3-phenylpropyl)piperidine-3-carboxamide (PubChem CID 3235839) has the molecular formula C24H29N3O2S
and a molecular weight of 423.58 g/mol. Its IUPAC name is 1-(4-ethylthieno[3,2-b]pyrrole-5-carbonyl)-N-(3-phenylpropyl)piperidine-3-carboxamide.
Molecular Properties
| Compound Name | 1-(4-ethylthieno[3,2-b]pyrrole-5-carbonyl)-N-(3-phenylpropyl)piperidine-3-carboxamide |
| PubChem CID | 3235839 |
| Molecular Formula | C24H29N3O2S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 1-(4-ethylthieno[3,2-b]pyrrole-5-carbonyl)-N-(3-phenylpropyl)piperidine-3-carboxamide |
| SMILES | CCn1c(C(=O)N2CCCC(C(=O)NCCCc3ccccc3)C2)cc2sccc21 |
| InChI | InChI=1S/C24H29N3O2S/c1-2-27-20-12-15-30-22(20)16-21(27)24(29)26-14-7-11-19(17-26)23(28)25-13-6-10-18-8-4-3-5-9-18/h3-5,8-9,12,15-16,19H,2,6-7,10-11,13-14,17H2,1H3,(H,25,28) |
| InChIKey | WCWAVFAPFPKZMA-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-ethylthieno[3,2-b]pyrrole-5-carbonyl)-N-(3-phenylpropyl)piperidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-ethylthieno[3,2-b]pyrrole-5-carbonyl)-N-(3-phenylpropyl)piperidine-3-carboxamide?
The IUPAC name of 1-(4-ethylthieno[3,2-b]pyrrole-5-carbonyl)-N-(3-phenylpropyl)piperidine-3-carboxamide (CID 3235839) is 1-(4-ethylthieno[3,2-b]pyrrole-5-carbonyl)-N-(3-phenylpropyl)piperidine-3-carboxamide.
What is the SMILES notation for 1-(4-ethylthieno[3,2-b]pyrrole-5-carbonyl)-N-(3-phenylpropyl)piperidine-3-carboxamide?
The canonical SMILES for 1-(4-ethylthieno[3,2-b]pyrrole-5-carbonyl)-N-(3-phenylpropyl)piperidine-3-carboxamide is CCn1c(C(=O)N2CCCC(C(=O)NCCCc3ccccc3)C2)cc2sccc21.
What is the InChIKey of 1-(4-ethylthieno[3,2-b]pyrrole-5-carbonyl)-N-(3-phenylpropyl)piperidine-3-carboxamide?
The InChIKey is WCWAVFAPFPKZMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H29N3O2S/c1-2-27-20-12-15-30-22(20)16-21(27)24(29)26-14-7-11-19(17-26)23(28)25-13-6-10-18-8-4-3-5-9-18/h3-5,8-9,12,15-16,19H,2,6-7,10-11,13-14,17H2,1H3,(H,25,28).
What are the key properties of 1-(4-ethylthieno[3,2-b]pyrrole-5-carbonyl)-N-(3-phenylpropyl)piperidine-3-carboxamide?
1-(4-ethylthieno[3,2-b]pyrrole-5-carbonyl)-N-(3-phenylpropyl)piperidine-3-carboxamide has a molecular weight of 423.58 g/mol, XLogP of 4.32, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-ethylthieno[3,2-b]pyrrole-5-carbonyl)-N-(3-phenylpropyl)piperidine-3-carboxamide is sourced from PubChem (CID 3235839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).