About ethyl 1-ethyl-3,5-dimethyl-4-(2-morpholin-4-ylethylcarbamoyl)pyrrole-2-carboxylate
ethyl 1-ethyl-3,5-dimethyl-4-(2-morpholin-4-ylethylcarbamoyl)pyrrole-2-carboxylate (PubChem CID 3236017) has the molecular formula C18H29N3O4
and a molecular weight of 351.45 g/mol. Its IUPAC name is ethyl 1-ethyl-3,5-dimethyl-4-(2-morpholin-4-ylethylcarbamoyl)pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-ethyl-3,5-dimethyl-4-(2-morpholin-4-ylethylcarbamoyl)pyrrole-2-carboxylate |
| PubChem CID | 3236017 |
| Molecular Formula | C18H29N3O4 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | ethyl 1-ethyl-3,5-dimethyl-4-(2-morpholin-4-ylethylcarbamoyl)pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1c(C)c(C(=O)NCCN2CCOCC2)c(C)n1CC |
| InChI | InChI=1S/C18H29N3O4/c1-5-21-14(4)15(13(3)16(21)18(23)25-6-2)17(22)19-7-8-20-9-11-24-12-10-20/h5-12H2,1-4H3,(H,19,22) |
| InChIKey | ROZRNHKQOQPQJU-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 1-ethyl-3,5-dimethyl-4-(2-morpholin-4-ylethylcarbamoyl)pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-ethyl-3,5-dimethyl-4-(2-morpholin-4-ylethylcarbamoyl)pyrrole-2-carboxylate?
The IUPAC name of ethyl 1-ethyl-3,5-dimethyl-4-(2-morpholin-4-ylethylcarbamoyl)pyrrole-2-carboxylate (CID 3236017) is ethyl 1-ethyl-3,5-dimethyl-4-(2-morpholin-4-ylethylcarbamoyl)pyrrole-2-carboxylate.
What is the SMILES notation for ethyl 1-ethyl-3,5-dimethyl-4-(2-morpholin-4-ylethylcarbamoyl)pyrrole-2-carboxylate?
The canonical SMILES for ethyl 1-ethyl-3,5-dimethyl-4-(2-morpholin-4-ylethylcarbamoyl)pyrrole-2-carboxylate is CCOC(=O)c1c(C)c(C(=O)NCCN2CCOCC2)c(C)n1CC.
What is the InChIKey of ethyl 1-ethyl-3,5-dimethyl-4-(2-morpholin-4-ylethylcarbamoyl)pyrrole-2-carboxylate?
The InChIKey is ROZRNHKQOQPQJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29N3O4/c1-5-21-14(4)15(13(3)16(21)18(23)25-6-2)17(22)19-7-8-20-9-11-24-12-10-20/h5-12H2,1-4H3,(H,19,22).
What are the key properties of ethyl 1-ethyl-3,5-dimethyl-4-(2-morpholin-4-ylethylcarbamoyl)pyrrole-2-carboxylate?
ethyl 1-ethyl-3,5-dimethyl-4-(2-morpholin-4-ylethylcarbamoyl)pyrrole-2-carboxylate has a molecular weight of 351.45 g/mol, XLogP of 1.36, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-ethyl-3,5-dimethyl-4-(2-morpholin-4-ylethylcarbamoyl)pyrrole-2-carboxylate is sourced from PubChem (CID 3236017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).