C15H14F3N3O4S — CID 3236054
methyl 2-[(4-cyclopropyl-1,3-thiazol-2-yl)amino]-3,3,3-trifluoro-2-(furan-2-carbonylamino)propanoate (PubChem CID 3236054) has the molecular formula C15H14F3N3O4S and a molecular weight of 389.36 g/mol. Its IUPAC name is methyl 2-[(4-cyclopropyl-1,3-thiazol-2-yl)amino]-3,3,3-trifluoro-2-(furan-2-carbonylamino)propanoate.
| Compound Name | methyl 2-[(4-cyclopropyl-1,3-thiazol-2-yl)amino]-3,3,3-trifluoro-2-(furan-2-carbonylamino)propanoate |
|---|---|
| PubChem CID | 3236054 |
| Molecular Formula | C15H14F3N3O4S |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | methyl 2-[(4-cyclopropyl-1,3-thiazol-2-yl)amino]-3,3,3-trifluoro-2-(furan-2-carbonylamino)propanoate |
| SMILES | COC(=O)C(NC(=O)c1ccco1)(Nc1nc(C2CC2)cs1)C(F)(F)F |
| InChI | InChI=1S/C15H14F3N3O4S/c1-24-12(23)14(15(16,17)18,20-11(22)10-3-2-6-25-10)21-13-19-9(7-26-13)8-4-5-8/h2-3,6-8H,4-5H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | GTNAADLPOIZJDC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|