About [3-[5-(hydroxymethyl)-2,3-dimethoxyphenyl]-4,5-dimethoxyphenyl]methanol
[3-[5-(hydroxymethyl)-2,3-dimethoxyphenyl]-4,5-dimethoxyphenyl]methanol (PubChem CID 3236060) has the molecular formula C18H22O6
and a molecular weight of 334.37 g/mol. Its IUPAC name is [3-[5-(hydroxymethyl)-2,3-dimethoxyphenyl]-4,5-dimethoxyphenyl]methanol.
Molecular Properties
| Compound Name | [3-[5-(hydroxymethyl)-2,3-dimethoxyphenyl]-4,5-dimethoxyphenyl]methanol |
| PubChem CID | 3236060 |
| Molecular Formula | C18H22O6 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | [3-[5-(hydroxymethyl)-2,3-dimethoxyphenyl]-4,5-dimethoxyphenyl]methanol |
| SMILES | COc1cc(CO)cc(-c2cc(CO)cc(OC)c2OC)c1OC |
| InChI | InChI=1S/C18H22O6/c1-21-15-7-11(9-19)5-13(17(15)23-3)14-6-12(10-20)8-16(22-2)18(14)24-4/h5-8,19-20H,9-10H2,1-4H3 |
| InChIKey | JTWMBPWZXQWMPH-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [3-[5-(hydroxymethyl)-2,3-dimethoxyphenyl]-4,5-dimethoxyphenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[5-(hydroxymethyl)-2,3-dimethoxyphenyl]-4,5-dimethoxyphenyl]methanol?
The IUPAC name of [3-[5-(hydroxymethyl)-2,3-dimethoxyphenyl]-4,5-dimethoxyphenyl]methanol (CID 3236060) is [3-[5-(hydroxymethyl)-2,3-dimethoxyphenyl]-4,5-dimethoxyphenyl]methanol.
What is the SMILES notation for [3-[5-(hydroxymethyl)-2,3-dimethoxyphenyl]-4,5-dimethoxyphenyl]methanol?
The canonical SMILES for [3-[5-(hydroxymethyl)-2,3-dimethoxyphenyl]-4,5-dimethoxyphenyl]methanol is COc1cc(CO)cc(-c2cc(CO)cc(OC)c2OC)c1OC.
What is the InChIKey of [3-[5-(hydroxymethyl)-2,3-dimethoxyphenyl]-4,5-dimethoxyphenyl]methanol?
The InChIKey is JTWMBPWZXQWMPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22O6/c1-21-15-7-11(9-19)5-13(17(15)23-3)14-6-12(10-20)8-16(22-2)18(14)24-4/h5-8,19-20H,9-10H2,1-4H3.
What are the key properties of [3-[5-(hydroxymethyl)-2,3-dimethoxyphenyl]-4,5-dimethoxyphenyl]methanol?
[3-[5-(hydroxymethyl)-2,3-dimethoxyphenyl]-4,5-dimethoxyphenyl]methanol has a molecular weight of 334.37 g/mol, XLogP of 2.37, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[5-(hydroxymethyl)-2,3-dimethoxyphenyl]-4,5-dimethoxyphenyl]methanol is sourced from PubChem (CID 3236060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).