About 2-(2,5-dimethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]sulfonyl-1,3-thiazolidine
2-(2,5-dimethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]sulfonyl-1,3-thiazolidine (PubChem CID 3236242) has the molecular formula C18H18F3NO4S2
and a molecular weight of 433.47 g/mol. Its IUPAC name is 2-(2,5-dimethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]sulfonyl-1,3-thiazolidine.
Molecular Properties
| Compound Name | 2-(2,5-dimethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]sulfonyl-1,3-thiazolidine |
| PubChem CID | 3236242 |
| Molecular Formula | C18H18F3NO4S2 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.06 |
| IUPAC Name | 2-(2,5-dimethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]sulfonyl-1,3-thiazolidine |
| SMILES | COc1ccc(OC)c(C2SCCN2S(=O)(=O)c2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C18H18F3NO4S2/c1-25-13-6-7-16(26-2)15(11-13)17-22(8-9-27-17)28(23,24)14-5-3-4-12(10-14)18(19,20)21/h3-7,10-11,17H,8-9H2,1-2H3 |
| InChIKey | KSDJIBVCBHSLLZ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2,5-dimethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]sulfonyl-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dimethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]sulfonyl-1,3-thiazolidine?
The IUPAC name of 2-(2,5-dimethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]sulfonyl-1,3-thiazolidine (CID 3236242) is 2-(2,5-dimethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]sulfonyl-1,3-thiazolidine.
What is the SMILES notation for 2-(2,5-dimethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]sulfonyl-1,3-thiazolidine?
The canonical SMILES for 2-(2,5-dimethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]sulfonyl-1,3-thiazolidine is COc1ccc(OC)c(C2SCCN2S(=O)(=O)c2cccc(C(F)(F)F)c2)c1.
What is the InChIKey of 2-(2,5-dimethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]sulfonyl-1,3-thiazolidine?
The InChIKey is KSDJIBVCBHSLLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18F3NO4S2/c1-25-13-6-7-16(26-2)15(11-13)17-22(8-9-27-17)28(23,24)14-5-3-4-12(10-14)18(19,20)21/h3-7,10-11,17H,8-9H2,1-2H3.
What are the key properties of 2-(2,5-dimethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]sulfonyl-1,3-thiazolidine?
2-(2,5-dimethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]sulfonyl-1,3-thiazolidine has a molecular weight of 433.47 g/mol, XLogP of 4.16, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dimethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]sulfonyl-1,3-thiazolidine is sourced from PubChem (CID 3236242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).