About 3-cyclohexyl-6-(3,5-dimethylanilino)-1H-pyrimidine-2,4-dione
3-cyclohexyl-6-(3,5-dimethylanilino)-1H-pyrimidine-2,4-dione (PubChem CID 3236251) has the molecular formula C18H23N3O2
and a molecular weight of 313.40 g/mol. Its IUPAC name is 3-cyclohexyl-6-(3,5-dimethylanilino)-1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 3-cyclohexyl-6-(3,5-dimethylanilino)-1H-pyrimidine-2,4-dione |
| PubChem CID | 3236251 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 3-cyclohexyl-6-(3,5-dimethylanilino)-1H-pyrimidine-2,4-dione |
| SMILES | Cc1cc(C)cc(Nc2cc(=O)n(C3CCCCC3)c(=O)[nH]2)c1 |
| InChI | InChI=1S/C18H23N3O2/c1-12-8-13(2)10-14(9-12)19-16-11-17(22)21(18(23)20-16)15-6-4-3-5-7-15/h8-11,15,19H,3-7H2,1-2H3,(H,20,23) |
| InChIKey | MOIQGFCOLCMBIH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-cyclohexyl-6-(3,5-dimethylanilino)-1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyl-6-(3,5-dimethylanilino)-1H-pyrimidine-2,4-dione?
The IUPAC name of 3-cyclohexyl-6-(3,5-dimethylanilino)-1H-pyrimidine-2,4-dione (CID 3236251) is 3-cyclohexyl-6-(3,5-dimethylanilino)-1H-pyrimidine-2,4-dione.
What is the SMILES notation for 3-cyclohexyl-6-(3,5-dimethylanilino)-1H-pyrimidine-2,4-dione?
The canonical SMILES for 3-cyclohexyl-6-(3,5-dimethylanilino)-1H-pyrimidine-2,4-dione is Cc1cc(C)cc(Nc2cc(=O)n(C3CCCCC3)c(=O)[nH]2)c1.
What is the InChIKey of 3-cyclohexyl-6-(3,5-dimethylanilino)-1H-pyrimidine-2,4-dione?
The InChIKey is MOIQGFCOLCMBIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N3O2/c1-12-8-13(2)10-14(9-12)19-16-11-17(22)21(18(23)20-16)15-6-4-3-5-7-15/h8-11,15,19H,3-7H2,1-2H3,(H,20,23).
What are the key properties of 3-cyclohexyl-6-(3,5-dimethylanilino)-1H-pyrimidine-2,4-dione?
3-cyclohexyl-6-(3,5-dimethylanilino)-1H-pyrimidine-2,4-dione has a molecular weight of 313.40 g/mol, XLogP of 3.40, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyl-6-(3,5-dimethylanilino)-1H-pyrimidine-2,4-dione is sourced from PubChem (CID 3236251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).