About N-[1-(1-ethylbenzimidazol-2-yl)ethyl]-3,4-dimethoxybenzamide
N-[1-(1-ethylbenzimidazol-2-yl)ethyl]-3,4-dimethoxybenzamide (PubChem CID 3236285) has the molecular formula C20H23N3O3
and a molecular weight of 353.42 g/mol. Its IUPAC name is N-[1-(1-ethylbenzimidazol-2-yl)ethyl]-3,4-dimethoxybenzamide.
Molecular Properties
| Compound Name | N-[1-(1-ethylbenzimidazol-2-yl)ethyl]-3,4-dimethoxybenzamide |
| PubChem CID | 3236285 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | N-[1-(1-ethylbenzimidazol-2-yl)ethyl]-3,4-dimethoxybenzamide |
| SMILES | CCn1c(C(C)NC(=O)c2ccc(OC)c(OC)c2)nc2ccccc21 |
| InChI | InChI=1S/C20H23N3O3/c1-5-23-16-9-7-6-8-15(16)22-19(23)13(2)21-20(24)14-10-11-17(25-3)18(12-14)26-4/h6-13H,5H2,1-4H3,(H,21,24) |
| InChIKey | AOESDHHCNPWKEQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[1-(1-ethylbenzimidazol-2-yl)ethyl]-3,4-dimethoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(1-ethylbenzimidazol-2-yl)ethyl]-3,4-dimethoxybenzamide?
The IUPAC name of N-[1-(1-ethylbenzimidazol-2-yl)ethyl]-3,4-dimethoxybenzamide (CID 3236285) is N-[1-(1-ethylbenzimidazol-2-yl)ethyl]-3,4-dimethoxybenzamide.
What is the SMILES notation for N-[1-(1-ethylbenzimidazol-2-yl)ethyl]-3,4-dimethoxybenzamide?
The canonical SMILES for N-[1-(1-ethylbenzimidazol-2-yl)ethyl]-3,4-dimethoxybenzamide is CCn1c(C(C)NC(=O)c2ccc(OC)c(OC)c2)nc2ccccc21.
What is the InChIKey of N-[1-(1-ethylbenzimidazol-2-yl)ethyl]-3,4-dimethoxybenzamide?
The InChIKey is AOESDHHCNPWKEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23N3O3/c1-5-23-16-9-7-6-8-15(16)22-19(23)13(2)21-20(24)14-10-11-17(25-3)18(12-14)26-4/h6-13H,5H2,1-4H3,(H,21,24).
What are the key properties of N-[1-(1-ethylbenzimidazol-2-yl)ethyl]-3,4-dimethoxybenzamide?
N-[1-(1-ethylbenzimidazol-2-yl)ethyl]-3,4-dimethoxybenzamide has a molecular weight of 353.42 g/mol, XLogP of 3.56, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(1-ethylbenzimidazol-2-yl)ethyl]-3,4-dimethoxybenzamide is sourced from PubChem (CID 3236285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).