About ethyl 4-(2,1,3-benzothiadiazol-4-ylsulfonyl)piperazine-1-carboxylate
ethyl 4-(2,1,3-benzothiadiazol-4-ylsulfonyl)piperazine-1-carboxylate (PubChem CID 3236286) has the molecular formula C13H16N4O4S2
and a molecular weight of 356.43 g/mol. Its IUPAC name is ethyl 4-(2,1,3-benzothiadiazol-4-ylsulfonyl)piperazine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-(2,1,3-benzothiadiazol-4-ylsulfonyl)piperazine-1-carboxylate |
| PubChem CID | 3236286 |
| Molecular Formula | C13H16N4O4S2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | ethyl 4-(2,1,3-benzothiadiazol-4-ylsulfonyl)piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(S(=O)(=O)c2cccc3nsnc23)CC1 |
| InChI | InChI=1S/C13H16N4O4S2/c1-2-21-13(18)16-6-8-17(9-7-16)23(19,20)11-5-3-4-10-12(11)15-22-14-10/h3-5H,2,6-9H2,1H3 |
| InChIKey | HKKDICPLWRXOEP-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 92.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 4-(2,1,3-benzothiadiazol-4-ylsulfonyl)piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(2,1,3-benzothiadiazol-4-ylsulfonyl)piperazine-1-carboxylate?
The IUPAC name of ethyl 4-(2,1,3-benzothiadiazol-4-ylsulfonyl)piperazine-1-carboxylate (CID 3236286) is ethyl 4-(2,1,3-benzothiadiazol-4-ylsulfonyl)piperazine-1-carboxylate.
What is the SMILES notation for ethyl 4-(2,1,3-benzothiadiazol-4-ylsulfonyl)piperazine-1-carboxylate?
The canonical SMILES for ethyl 4-(2,1,3-benzothiadiazol-4-ylsulfonyl)piperazine-1-carboxylate is CCOC(=O)N1CCN(S(=O)(=O)c2cccc3nsnc23)CC1.
What is the InChIKey of ethyl 4-(2,1,3-benzothiadiazol-4-ylsulfonyl)piperazine-1-carboxylate?
The InChIKey is HKKDICPLWRXOEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4O4S2/c1-2-21-13(18)16-6-8-17(9-7-16)23(19,20)11-5-3-4-10-12(11)15-22-14-10/h3-5H,2,6-9H2,1H3.
What are the key properties of ethyl 4-(2,1,3-benzothiadiazol-4-ylsulfonyl)piperazine-1-carboxylate?
ethyl 4-(2,1,3-benzothiadiazol-4-ylsulfonyl)piperazine-1-carboxylate has a molecular weight of 356.43 g/mol, XLogP of 1.15, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(2,1,3-benzothiadiazol-4-ylsulfonyl)piperazine-1-carboxylate is sourced from PubChem (CID 3236286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).