About [2-methyl-1-(3,4,5-trimethoxyphenyl)benzimidazol-5-yl]-morpholin-4-ylmethanone
[2-methyl-1-(3,4,5-trimethoxyphenyl)benzimidazol-5-yl]-morpholin-4-ylmethanone (PubChem CID 3236300) has the molecular formula C22H25N3O5
and a molecular weight of 411.46 g/mol. Its IUPAC name is [2-methyl-1-(3,4,5-trimethoxyphenyl)benzimidazol-5-yl]-morpholin-4-ylmethanone.
Molecular Properties
| Compound Name | [2-methyl-1-(3,4,5-trimethoxyphenyl)benzimidazol-5-yl]-morpholin-4-ylmethanone |
| PubChem CID | 3236300 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | [2-methyl-1-(3,4,5-trimethoxyphenyl)benzimidazol-5-yl]-morpholin-4-ylmethanone |
| SMILES | COc1cc(-n2c(C)nc3cc(C(=O)N4CCOCC4)ccc32)cc(OC)c1OC |
| InChI | InChI=1S/C22H25N3O5/c1-14-23-17-11-15(22(26)24-7-9-30-10-8-24)5-6-18(17)25(14)16-12-19(27-2)21(29-4)20(13-16)28-3/h5-6,11-13H,7-10H2,1-4H3 |
| InChIKey | HBALOEWXHYLEGB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 75.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [2-methyl-1-(3,4,5-trimethoxyphenyl)benzimidazol-5-yl]-morpholin-4-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-methyl-1-(3,4,5-trimethoxyphenyl)benzimidazol-5-yl]-morpholin-4-ylmethanone?
The IUPAC name of [2-methyl-1-(3,4,5-trimethoxyphenyl)benzimidazol-5-yl]-morpholin-4-ylmethanone (CID 3236300) is [2-methyl-1-(3,4,5-trimethoxyphenyl)benzimidazol-5-yl]-morpholin-4-ylmethanone.
What is the SMILES notation for [2-methyl-1-(3,4,5-trimethoxyphenyl)benzimidazol-5-yl]-morpholin-4-ylmethanone?
The canonical SMILES for [2-methyl-1-(3,4,5-trimethoxyphenyl)benzimidazol-5-yl]-morpholin-4-ylmethanone is COc1cc(-n2c(C)nc3cc(C(=O)N4CCOCC4)ccc32)cc(OC)c1OC.
What is the InChIKey of [2-methyl-1-(3,4,5-trimethoxyphenyl)benzimidazol-5-yl]-morpholin-4-ylmethanone?
The InChIKey is HBALOEWXHYLEGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N3O5/c1-14-23-17-11-15(22(26)24-7-9-30-10-8-24)5-6-18(17)25(14)16-12-19(27-2)21(29-4)20(13-16)28-3/h5-6,11-13H,7-10H2,1-4H3.
What are the key properties of [2-methyl-1-(3,4,5-trimethoxyphenyl)benzimidazol-5-yl]-morpholin-4-ylmethanone?
[2-methyl-1-(3,4,5-trimethoxyphenyl)benzimidazol-5-yl]-morpholin-4-ylmethanone has a molecular weight of 411.46 g/mol, XLogP of 2.83, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-methyl-1-(3,4,5-trimethoxyphenyl)benzimidazol-5-yl]-morpholin-4-ylmethanone is sourced from PubChem (CID 3236300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).