C20H25FN4OS — CID 3236573
N-[3-(diethylamino)propyl]-6-(4-fluorophenyl)-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxamide (PubChem CID 3236573) has the molecular formula C20H25FN4OS and a molecular weight of 388.51 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-6-(4-fluorophenyl)-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxamide.
| Compound Name | N-[3-(diethylamino)propyl]-6-(4-fluorophenyl)-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxamide |
|---|---|
| PubChem CID | 3236573 |
| Molecular Formula | C20H25FN4OS |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | N-[3-(diethylamino)propyl]-6-(4-fluorophenyl)-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxamide |
| SMILES | CCN(CC)CCCNC(=O)c1sc2nc(-c3ccc(F)cc3)cn2c1C |
| InChI | InChI=1S/C20H25FN4OS/c1-4-24(5-2)12-6-11-22-19(26)18-14(3)25-13-17(23-20(25)27-18)15-7-9-16(21)10-8-15/h7-10,13H,4-6,11-12H2,1-3H3,(H,22,26) |
| InChIKey | WCINHGXSAOQBRE-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|