About 3-[(4-methylphenyl)sulfonylamino]propyl N-pyridin-4-ylcarbamate
3-[(4-methylphenyl)sulfonylamino]propyl N-pyridin-4-ylcarbamate (PubChem CID 3236724) has the molecular formula C16H19N3O4S
and a molecular weight of 349.41 g/mol. Its IUPAC name is 3-[(4-methylphenyl)sulfonylamino]propyl N-pyridin-4-ylcarbamate.
Molecular Properties
| Compound Name | 3-[(4-methylphenyl)sulfonylamino]propyl N-pyridin-4-ylcarbamate |
| PubChem CID | 3236724 |
| Molecular Formula | C16H19N3O4S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 3-[(4-methylphenyl)sulfonylamino]propyl N-pyridin-4-ylcarbamate |
| SMILES | Cc1ccc(S(=O)(=O)NCCCOC(=O)Nc2ccncc2)cc1 |
| InChI | InChI=1S/C16H19N3O4S/c1-13-3-5-15(6-4-13)24(21,22)18-9-2-12-23-16(20)19-14-7-10-17-11-8-14/h3-8,10-11,18H,2,9,12H2,1H3,(H,17,19,20) |
| InChIKey | ITYCDQJBLCTIID-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4-methylphenyl)sulfonylamino]propyl N-pyridin-4-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-methylphenyl)sulfonylamino]propyl N-pyridin-4-ylcarbamate?
The IUPAC name of 3-[(4-methylphenyl)sulfonylamino]propyl N-pyridin-4-ylcarbamate (CID 3236724) is 3-[(4-methylphenyl)sulfonylamino]propyl N-pyridin-4-ylcarbamate.
What is the SMILES notation for 3-[(4-methylphenyl)sulfonylamino]propyl N-pyridin-4-ylcarbamate?
The canonical SMILES for 3-[(4-methylphenyl)sulfonylamino]propyl N-pyridin-4-ylcarbamate is Cc1ccc(S(=O)(=O)NCCCOC(=O)Nc2ccncc2)cc1.
What is the InChIKey of 3-[(4-methylphenyl)sulfonylamino]propyl N-pyridin-4-ylcarbamate?
The InChIKey is ITYCDQJBLCTIID-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O4S/c1-13-3-5-15(6-4-13)24(21,22)18-9-2-12-23-16(20)19-14-7-10-17-11-8-14/h3-8,10-11,18H,2,9,12H2,1H3,(H,17,19,20).
What are the key properties of 3-[(4-methylphenyl)sulfonylamino]propyl N-pyridin-4-ylcarbamate?
3-[(4-methylphenyl)sulfonylamino]propyl N-pyridin-4-ylcarbamate has a molecular weight of 349.41 g/mol, XLogP of 2.31, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-methylphenyl)sulfonylamino]propyl N-pyridin-4-ylcarbamate is sourced from PubChem (CID 3236724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).