C19H25N3O6 — CID 3236741
N-(2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),8-trien-8-yl)-2-morpholin-4-ylacetamide;oxalic acid (PubChem CID 3236741) has the molecular formula C19H25N3O6 and a molecular weight of 391.42 g/mol. Its IUPAC name is N-(2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),8-trien-8-yl)-2-morpholin-4-ylacetamide;oxalic acid.
| Compound Name | N-(2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),8-trien-8-yl)-2-morpholin-4-ylacetamide;oxalic acid |
|---|---|
| PubChem CID | 3236741 |
| Molecular Formula | C19H25N3O6 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | N-(2-azatricyclo[7.3.0.03,7]dodeca-1,3(7),8-trien-8-yl)-2-morpholin-4-ylacetamide;oxalic acid |
| SMILES | O=C(CN1CCOCC1)Nc1c2c(nc3c1CCC3)CCC2.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H23N3O2.C2H2O4/c21-16(11-20-7-9-22-10-8-20)19-17-12-3-1-5-14(12)18-15-6-2-4-13(15)17;3-1(4)2(5)6/h1-11H2,(H,18,19,21);(H,3,4)(H,5,6) |
| InChIKey | UVIMNCNBGXYFOG-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 129.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|