C21H26N2O5 — CID 3236848
3-[2-(4-ethoxycarbonylpiperidin-1-yl)-2-oxoethyl]-1-ethylindole-2-carboxylic acid (PubChem CID 3236848) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is 3-[2-(4-ethoxycarbonylpiperidin-1-yl)-2-oxoethyl]-1-ethylindole-2-carboxylic acid.
| Compound Name | 3-[2-(4-ethoxycarbonylpiperidin-1-yl)-2-oxoethyl]-1-ethylindole-2-carboxylic acid |
|---|---|
| PubChem CID | 3236848 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 3-[2-(4-ethoxycarbonylpiperidin-1-yl)-2-oxoethyl]-1-ethylindole-2-carboxylic acid |
| SMILES | CCOC(=O)C1CCN(C(=O)Cc2c(C(=O)O)n(CC)c3ccccc23)CC1 |
| InChI | InChI=1S/C21H26N2O5/c1-3-23-17-8-6-5-7-15(17)16(19(23)20(25)26)13-18(24)22-11-9-14(10-12-22)21(27)28-4-2/h5-8,14H,3-4,9-13H2,1-2H3,(H,25,26) |
| InChIKey | UICRGRKWQPFXOF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|