C16H22N4O5S — CID 3236865
N-(2,5-diethoxyphenyl)-2-[1H-imidazol-5-ylsulfonyl(methyl)amino]acetamide (PubChem CID 3236865) has the molecular formula C16H22N4O5S and a molecular weight of 382.44 g/mol. Its IUPAC name is N-(2,5-diethoxyphenyl)-2-[1H-imidazol-5-ylsulfonyl(methyl)amino]acetamide.
| Compound Name | N-(2,5-diethoxyphenyl)-2-[1H-imidazol-5-ylsulfonyl(methyl)amino]acetamide |
|---|---|
| PubChem CID | 3236865 |
| Molecular Formula | C16H22N4O5S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | N-(2,5-diethoxyphenyl)-2-[1H-imidazol-5-ylsulfonyl(methyl)amino]acetamide |
| SMILES | CCOc1ccc(OCC)c(NC(=O)CN(C)S(=O)(=O)c2cnc[nH]2)c1 |
| InChI | InChI=1S/C16H22N4O5S/c1-4-24-12-6-7-14(25-5-2)13(8-12)19-15(21)10-20(3)26(22,23)16-9-17-11-18-16/h6-9,11H,4-5,10H2,1-3H3,(H,17,18)(H,19,21) |
| InChIKey | LRZDWHXTVMDOST-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 113.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |