About 6-methyl-2,4-dioxo-N-[2-(4-sulfamoylphenyl)ethyl]-1H-pyrimidine-5-sulfonamide
6-methyl-2,4-dioxo-N-[2-(4-sulfamoylphenyl)ethyl]-1H-pyrimidine-5-sulfonamide (PubChem CID 3236899) has the molecular formula C13H16N4O6S2
and a molecular weight of 388.43 g/mol. Its IUPAC name is 6-methyl-2,4-dioxo-N-[2-(4-sulfamoylphenyl)ethyl]-1H-pyrimidine-5-sulfonamide.
Molecular Properties
| Compound Name | 6-methyl-2,4-dioxo-N-[2-(4-sulfamoylphenyl)ethyl]-1H-pyrimidine-5-sulfonamide |
| PubChem CID | 3236899 |
| Molecular Formula | C13H16N4O6S2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | 6-methyl-2,4-dioxo-N-[2-(4-sulfamoylphenyl)ethyl]-1H-pyrimidine-5-sulfonamide |
| SMILES | Cc1[nH]c(=O)[nH]c(=O)c1S(=O)(=O)NCCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C13H16N4O6S2/c1-8-11(12(18)17-13(19)16-8)25(22,23)15-7-6-9-2-4-10(5-3-9)24(14,20)21/h2-5,15H,6-7H2,1H3,(H2,14,20,21)(H2,16,17,18,19) |
| InChIKey | GUGVHAKQICMXOH-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 172.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-methyl-2,4-dioxo-N-[2-(4-sulfamoylphenyl)ethyl]-1H-pyrimidine-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2,4-dioxo-N-[2-(4-sulfamoylphenyl)ethyl]-1H-pyrimidine-5-sulfonamide?
The IUPAC name of 6-methyl-2,4-dioxo-N-[2-(4-sulfamoylphenyl)ethyl]-1H-pyrimidine-5-sulfonamide (CID 3236899) is 6-methyl-2,4-dioxo-N-[2-(4-sulfamoylphenyl)ethyl]-1H-pyrimidine-5-sulfonamide.
What is the SMILES notation for 6-methyl-2,4-dioxo-N-[2-(4-sulfamoylphenyl)ethyl]-1H-pyrimidine-5-sulfonamide?
The canonical SMILES for 6-methyl-2,4-dioxo-N-[2-(4-sulfamoylphenyl)ethyl]-1H-pyrimidine-5-sulfonamide is Cc1[nH]c(=O)[nH]c(=O)c1S(=O)(=O)NCCc1ccc(S(N)(=O)=O)cc1.
What is the InChIKey of 6-methyl-2,4-dioxo-N-[2-(4-sulfamoylphenyl)ethyl]-1H-pyrimidine-5-sulfonamide?
The InChIKey is GUGVHAKQICMXOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4O6S2/c1-8-11(12(18)17-13(19)16-8)25(22,23)15-7-6-9-2-4-10(5-3-9)24(14,20)21/h2-5,15H,6-7H2,1H3,(H2,14,20,21)(H2,16,17,18,19).
What are the key properties of 6-methyl-2,4-dioxo-N-[2-(4-sulfamoylphenyl)ethyl]-1H-pyrimidine-5-sulfonamide?
6-methyl-2,4-dioxo-N-[2-(4-sulfamoylphenyl)ethyl]-1H-pyrimidine-5-sulfonamide has a molecular weight of 388.43 g/mol, XLogP of -1.46, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2,4-dioxo-N-[2-(4-sulfamoylphenyl)ethyl]-1H-pyrimidine-5-sulfonamide is sourced from PubChem (CID 3236899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).