About N-cyclohexyl-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidine-4-carboxamide
N-cyclohexyl-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidine-4-carboxamide (PubChem CID 3236901) has the molecular formula C18H30N4O3S
and a molecular weight of 382.53 g/mol. Its IUPAC name is N-cyclohexyl-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidine-4-carboxamide.
Molecular Properties
| Compound Name | N-cyclohexyl-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidine-4-carboxamide |
| PubChem CID | 3236901 |
| Molecular Formula | C18H30N4O3S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | N-cyclohexyl-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidine-4-carboxamide |
| SMILES | Cc1nn(C)c(C)c1S(=O)(=O)N1CCC(C(=O)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C18H30N4O3S/c1-13-17(14(2)21(3)20-13)26(24,25)22-11-9-15(10-12-22)18(23)19-16-7-5-4-6-8-16/h15-16H,4-12H2,1-3H3,(H,19,23) |
| InChIKey | PXTLCQXLZNLEGZ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-cyclohexyl-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidine-4-carboxamide?
The IUPAC name of N-cyclohexyl-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidine-4-carboxamide (CID 3236901) is N-cyclohexyl-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidine-4-carboxamide.
What is the SMILES notation for N-cyclohexyl-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidine-4-carboxamide?
The canonical SMILES for N-cyclohexyl-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidine-4-carboxamide is Cc1nn(C)c(C)c1S(=O)(=O)N1CCC(C(=O)NC2CCCCC2)CC1.
What is the InChIKey of N-cyclohexyl-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidine-4-carboxamide?
The InChIKey is PXTLCQXLZNLEGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30N4O3S/c1-13-17(14(2)21(3)20-13)26(24,25)22-11-9-15(10-12-22)18(23)19-16-7-5-4-6-8-16/h15-16H,4-12H2,1-3H3,(H,19,23).
What are the key properties of N-cyclohexyl-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidine-4-carboxamide?
N-cyclohexyl-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidine-4-carboxamide has a molecular weight of 382.53 g/mol, XLogP of 1.89, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidine-4-carboxamide is sourced from PubChem (CID 3236901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).