C18H17F3N4O3 — CID 3237005
9-(3,4-dimethoxyphenyl)-2-(trifluoromethyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 3237005) has the molecular formula C18H17F3N4O3 and a molecular weight of 394.35 g/mol. Its IUPAC name is 9-(3,4-dimethoxyphenyl)-2-(trifluoromethyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 9-(3,4-dimethoxyphenyl)-2-(trifluoromethyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 3237005 |
| Molecular Formula | C18H17F3N4O3 |
| Molecular Weight | 394.35 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 9-(3,4-dimethoxyphenyl)-2-(trifluoromethyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | COc1ccc(C2C3=C(CCCC3=O)Nc3nc(C(F)(F)F)nn32)cc1OC |
| InChI | InChI=1S/C18H17F3N4O3/c1-27-12-7-6-9(8-13(12)28-2)15-14-10(4-3-5-11(14)26)22-17-23-16(18(19,20)21)24-25(15)17/h6-8,15H,3-5H2,1-2H3,(H,22,23,24) |
| InChIKey | GBDKBLGCKLTLFE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |