About N-(3-ethylphenyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide
N-(3-ethylphenyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide (PubChem CID 3237078) has the molecular formula C13H17N3O2S
and a molecular weight of 279.37 g/mol. Its IUPAC name is N-(3-ethylphenyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide.
Molecular Properties
| Compound Name | N-(3-ethylphenyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide |
| PubChem CID | 3237078 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | N-(3-ethylphenyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide |
| SMILES | CCc1cccc(NS(=O)(=O)c2c(C)n[nH]c2C)c1 |
| InChI | InChI=1S/C13H17N3O2S/c1-4-11-6-5-7-12(8-11)16-19(17,18)13-9(2)14-15-10(13)3/h5-8,16H,4H2,1-3H3,(H,14,15) |
| InChIKey | WVYTWVSSIPRCOL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3-ethylphenyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-ethylphenyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide?
The IUPAC name of N-(3-ethylphenyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide (CID 3237078) is N-(3-ethylphenyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide.
What is the SMILES notation for N-(3-ethylphenyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide?
The canonical SMILES for N-(3-ethylphenyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide is CCc1cccc(NS(=O)(=O)c2c(C)n[nH]c2C)c1.
What is the InChIKey of N-(3-ethylphenyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide?
The InChIKey is WVYTWVSSIPRCOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O2S/c1-4-11-6-5-7-12(8-11)16-19(17,18)13-9(2)14-15-10(13)3/h5-8,16H,4H2,1-3H3,(H,14,15).
What are the key properties of N-(3-ethylphenyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide?
N-(3-ethylphenyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide has a molecular weight of 279.37 g/mol, XLogP of 2.39, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-ethylphenyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide is sourced from PubChem (CID 3237078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).