About ethyl 4-[2-(4-methoxyphenyl)imidazo[2,1-b][1,3]benzothiazole-6-carbonyl]piperazine-1-carboxylate
ethyl 4-[2-(4-methoxyphenyl)imidazo[2,1-b][1,3]benzothiazole-6-carbonyl]piperazine-1-carboxylate (PubChem CID 3237208) has the molecular formula C24H24N4O4S
and a molecular weight of 464.55 g/mol. Its IUPAC name is ethyl 4-[2-(4-methoxyphenyl)imidazo[2,1-b][1,3]benzothiazole-6-carbonyl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[2-(4-methoxyphenyl)imidazo[2,1-b][1,3]benzothiazole-6-carbonyl]piperazine-1-carboxylate |
| PubChem CID | 3237208 |
| Molecular Formula | C24H24N4O4S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | ethyl 4-[2-(4-methoxyphenyl)imidazo[2,1-b][1,3]benzothiazole-6-carbonyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)c2ccc3c(c2)sc2nc(-c4ccc(OC)cc4)cn23)CC1 |
| InChI | InChI=1S/C24H24N4O4S/c1-3-32-24(30)27-12-10-26(11-13-27)22(29)17-6-9-20-21(14-17)33-23-25-19(15-28(20)23)16-4-7-18(31-2)8-5-16/h4-9,14-15H,3,10-13H2,1-2H3 |
| InChIKey | JMNIMECMVSKGKS-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 76.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 4-[2-(4-methoxyphenyl)imidazo[2,1-b][1,3]benzothiazole-6-carbonyl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[2-(4-methoxyphenyl)imidazo[2,1-b][1,3]benzothiazole-6-carbonyl]piperazine-1-carboxylate?
The IUPAC name of ethyl 4-[2-(4-methoxyphenyl)imidazo[2,1-b][1,3]benzothiazole-6-carbonyl]piperazine-1-carboxylate (CID 3237208) is ethyl 4-[2-(4-methoxyphenyl)imidazo[2,1-b][1,3]benzothiazole-6-carbonyl]piperazine-1-carboxylate.
What is the SMILES notation for ethyl 4-[2-(4-methoxyphenyl)imidazo[2,1-b][1,3]benzothiazole-6-carbonyl]piperazine-1-carboxylate?
The canonical SMILES for ethyl 4-[2-(4-methoxyphenyl)imidazo[2,1-b][1,3]benzothiazole-6-carbonyl]piperazine-1-carboxylate is CCOC(=O)N1CCN(C(=O)c2ccc3c(c2)sc2nc(-c4ccc(OC)cc4)cn23)CC1.
What is the InChIKey of ethyl 4-[2-(4-methoxyphenyl)imidazo[2,1-b][1,3]benzothiazole-6-carbonyl]piperazine-1-carboxylate?
The InChIKey is JMNIMECMVSKGKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24N4O4S/c1-3-32-24(30)27-12-10-26(11-13-27)22(29)17-6-9-20-21(14-17)33-23-25-19(15-28(20)23)16-4-7-18(31-2)8-5-16/h4-9,14-15H,3,10-13H2,1-2H3.
What are the key properties of ethyl 4-[2-(4-methoxyphenyl)imidazo[2,1-b][1,3]benzothiazole-6-carbonyl]piperazine-1-carboxylate?
ethyl 4-[2-(4-methoxyphenyl)imidazo[2,1-b][1,3]benzothiazole-6-carbonyl]piperazine-1-carboxylate has a molecular weight of 464.55 g/mol, XLogP of 4.14, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[2-(4-methoxyphenyl)imidazo[2,1-b][1,3]benzothiazole-6-carbonyl]piperazine-1-carboxylate is sourced from PubChem (CID 3237208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).