C15H11NO5S2 — CID 3237412
methyl 9,15-dioxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraene-11-carboxylate (PubChem CID 3237412) has the molecular formula C15H11NO5S2 and a molecular weight of 349.39 g/mol. Its IUPAC name is methyl 9,15-dioxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraene-11-carboxylate.
| Compound Name | methyl 9,15-dioxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraene-11-carboxylate |
|---|---|
| PubChem CID | 3237412 |
| Molecular Formula | C15H11NO5S2 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | methyl 9,15-dioxo-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2,4,6,13(17)-tetraene-11-carboxylate |
| SMILES | COC(=O)C1Sc2[nH]c(=O)sc2C2c3ccccc3OC(=O)C12 |
| InChI | InChI=1S/C15H11NO5S2/c1-20-14(18)11-9-8(10-12(22-11)16-15(19)23-10)6-4-2-3-5-7(6)21-13(9)17/h2-5,8-9,11H,1H3,(H,16,19) |
| InChIKey | PRQQFNDOCVAYKE-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|