About methyl 2-(3-oxobutyl)benzoate
methyl 2-(3-oxobutyl)benzoate (PubChem CID 3237420) has the molecular formula C12H14O3
and a molecular weight of 206.24 g/mol. Its IUPAC name is methyl 2-(3-oxobutyl)benzoate.
Molecular Properties
| Compound Name | methyl 2-(3-oxobutyl)benzoate |
| PubChem CID | 3237420 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | methyl 2-(3-oxobutyl)benzoate |
| SMILES | COC(=O)c1ccccc1CCC(C)=O |
| InChI | InChI=1S/C12H14O3/c1-9(13)7-8-10-5-3-4-6-11(10)12(14)15-2/h3-6H,7-8H2,1-2H3 |
| InChIKey | BOLLAGMWXGVAOD-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-(3-oxobutyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(3-oxobutyl)benzoate?
The IUPAC name of methyl 2-(3-oxobutyl)benzoate (CID 3237420) is methyl 2-(3-oxobutyl)benzoate.
What is the SMILES notation for methyl 2-(3-oxobutyl)benzoate?
The canonical SMILES for methyl 2-(3-oxobutyl)benzoate is COC(=O)c1ccccc1CCC(C)=O.
What is the InChIKey of methyl 2-(3-oxobutyl)benzoate?
The InChIKey is BOLLAGMWXGVAOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O3/c1-9(13)7-8-10-5-3-4-6-11(10)12(14)15-2/h3-6H,7-8H2,1-2H3.
What are the key properties of methyl 2-(3-oxobutyl)benzoate?
methyl 2-(3-oxobutyl)benzoate has a molecular weight of 206.24 g/mol, XLogP of 1.99, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3-oxobutyl)benzoate is sourced from PubChem (CID 3237420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).