About ethyl 4-[(3-oxo-4H-1,4-benzothiazin-7-yl)sulfonyl]piperazine-1-carboxylate
ethyl 4-[(3-oxo-4H-1,4-benzothiazin-7-yl)sulfonyl]piperazine-1-carboxylate (PubChem CID 3237519) has the molecular formula C15H19N3O5S2
and a molecular weight of 385.47 g/mol. Its IUPAC name is ethyl 4-[(3-oxo-4H-1,4-benzothiazin-7-yl)sulfonyl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[(3-oxo-4H-1,4-benzothiazin-7-yl)sulfonyl]piperazine-1-carboxylate |
| PubChem CID | 3237519 |
| Molecular Formula | C15H19N3O5S2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | ethyl 4-[(3-oxo-4H-1,4-benzothiazin-7-yl)sulfonyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(S(=O)(=O)c2ccc3c(c2)SCC(=O)N3)CC1 |
| InChI | InChI=1S/C15H19N3O5S2/c1-2-23-15(20)17-5-7-18(8-6-17)25(21,22)11-3-4-12-13(9-11)24-10-14(19)16-12/h3-4,9H,2,5-8,10H2,1H3,(H,16,19) |
| InChIKey | JYDNGGLSEWJSMA-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 4-[(3-oxo-4H-1,4-benzothiazin-7-yl)sulfonyl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[(3-oxo-4H-1,4-benzothiazin-7-yl)sulfonyl]piperazine-1-carboxylate?
The IUPAC name of ethyl 4-[(3-oxo-4H-1,4-benzothiazin-7-yl)sulfonyl]piperazine-1-carboxylate (CID 3237519) is ethyl 4-[(3-oxo-4H-1,4-benzothiazin-7-yl)sulfonyl]piperazine-1-carboxylate.
What is the SMILES notation for ethyl 4-[(3-oxo-4H-1,4-benzothiazin-7-yl)sulfonyl]piperazine-1-carboxylate?
The canonical SMILES for ethyl 4-[(3-oxo-4H-1,4-benzothiazin-7-yl)sulfonyl]piperazine-1-carboxylate is CCOC(=O)N1CCN(S(=O)(=O)c2ccc3c(c2)SCC(=O)N3)CC1.
What is the InChIKey of ethyl 4-[(3-oxo-4H-1,4-benzothiazin-7-yl)sulfonyl]piperazine-1-carboxylate?
The InChIKey is JYDNGGLSEWJSMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O5S2/c1-2-23-15(20)17-5-7-18(8-6-17)25(21,22)11-3-4-12-13(9-11)24-10-14(19)16-12/h3-4,9H,2,5-8,10H2,1H3,(H,16,19).
What are the key properties of ethyl 4-[(3-oxo-4H-1,4-benzothiazin-7-yl)sulfonyl]piperazine-1-carboxylate?
ethyl 4-[(3-oxo-4H-1,4-benzothiazin-7-yl)sulfonyl]piperazine-1-carboxylate has a molecular weight of 385.47 g/mol, XLogP of 1.19, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[(3-oxo-4H-1,4-benzothiazin-7-yl)sulfonyl]piperazine-1-carboxylate is sourced from PubChem (CID 3237519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).