About ethyl 4-[[2-[N-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-4-methylanilino]acetyl]amino]benzoate
ethyl 4-[[2-[N-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-4-methylanilino]acetyl]amino]benzoate (PubChem CID 3237575) has the molecular formula C23H26N4O5S
and a molecular weight of 470.55 g/mol. Its IUPAC name is ethyl 4-[[2-[N-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-4-methylanilino]acetyl]amino]benzoate.
Molecular Properties
| Compound Name | ethyl 4-[[2-[N-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-4-methylanilino]acetyl]amino]benzoate |
| PubChem CID | 3237575 |
| Molecular Formula | C23H26N4O5S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | ethyl 4-[[2-[N-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-4-methylanilino]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CN(c2ccc(C)cc2)S(=O)(=O)c2c(C)n[nH]c2C)cc1 |
| InChI | InChI=1S/C23H26N4O5S/c1-5-32-23(29)18-8-10-19(11-9-18)24-21(28)14-27(20-12-6-15(2)7-13-20)33(30,31)22-16(3)25-26-17(22)4/h6-13H,5,14H2,1-4H3,(H,24,28)(H,25,26) |
| InChIKey | BHFWQQBHYVGVHX-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 121.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 4-[[2-[N-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-4-methylanilino]acetyl]amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[[2-[N-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-4-methylanilino]acetyl]amino]benzoate?
The IUPAC name of ethyl 4-[[2-[N-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-4-methylanilino]acetyl]amino]benzoate (CID 3237575) is ethyl 4-[[2-[N-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-4-methylanilino]acetyl]amino]benzoate.
What is the SMILES notation for ethyl 4-[[2-[N-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-4-methylanilino]acetyl]amino]benzoate?
The canonical SMILES for ethyl 4-[[2-[N-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-4-methylanilino]acetyl]amino]benzoate is CCOC(=O)c1ccc(NC(=O)CN(c2ccc(C)cc2)S(=O)(=O)c2c(C)n[nH]c2C)cc1.
What is the InChIKey of ethyl 4-[[2-[N-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-4-methylanilino]acetyl]amino]benzoate?
The InChIKey is BHFWQQBHYVGVHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26N4O5S/c1-5-32-23(29)18-8-10-19(11-9-18)24-21(28)14-27(20-12-6-15(2)7-13-20)33(30,31)22-16(3)25-26-17(22)4/h6-13H,5,14H2,1-4H3,(H,24,28)(H,25,26).
What are the key properties of ethyl 4-[[2-[N-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-4-methylanilino]acetyl]amino]benzoate?
ethyl 4-[[2-[N-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-4-methylanilino]acetyl]amino]benzoate has a molecular weight of 470.55 g/mol, XLogP of 3.35, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[[2-[N-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-4-methylanilino]acetyl]amino]benzoate is sourced from PubChem (CID 3237575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).