C25H30ClN5O2 — CID 3237661
N-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-3-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]propanamide (PubChem CID 3237661) has the molecular formula C25H30ClN5O2 and a molecular weight of 468.00 g/mol. Its IUPAC name is N-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-3-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]propanamide.
| Compound Name | N-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-3-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]propanamide |
|---|---|
| PubChem CID | 3237661 |
| Molecular Formula | C25H30ClN5O2 |
| Molecular Weight | 468.00 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | N-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-3-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]propanamide |
| SMILES | Cc1ccc(-c2noc(CCC(=O)NCCCN3CCN(c4cccc(Cl)c4)CC3)n2)cc1 |
| InChI | InChI=1S/C25H30ClN5O2/c1-19-6-8-20(9-7-19)25-28-24(33-29-25)11-10-23(32)27-12-3-13-30-14-16-31(17-15-30)22-5-2-4-21(26)18-22/h2,4-9,18H,3,10-17H2,1H3,(H,27,32) |
| InChIKey | JCLWLOGOGKBEGR-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.00 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|