About 5-methyl-2-pentyl-[1,3]oxazolo[4,5-c]quinolin-4-one
5-methyl-2-pentyl-[1,3]oxazolo[4,5-c]quinolin-4-one (PubChem CID 3237789) has the molecular formula C16H18N2O2
and a molecular weight of 270.33 g/mol. Its IUPAC name is 5-methyl-2-pentyl-[1,3]oxazolo[4,5-c]quinolin-4-one.
Molecular Properties
| Compound Name | 5-methyl-2-pentyl-[1,3]oxazolo[4,5-c]quinolin-4-one |
| PubChem CID | 3237789 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 5-methyl-2-pentyl-[1,3]oxazolo[4,5-c]quinolin-4-one |
| SMILES | CCCCCc1nc2c(=O)n(C)c3ccccc3c2o1 |
| InChI | InChI=1S/C16H18N2O2/c1-3-4-5-10-13-17-14-15(20-13)11-8-6-7-9-12(11)18(2)16(14)19/h6-9H,3-5,10H2,1-2H3 |
| InChIKey | SFMYXHZHBYETOR-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-2-pentyl-[1,3]oxazolo[4,5-c]quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-pentyl-[1,3]oxazolo[4,5-c]quinolin-4-one?
The IUPAC name of 5-methyl-2-pentyl-[1,3]oxazolo[4,5-c]quinolin-4-one (CID 3237789) is 5-methyl-2-pentyl-[1,3]oxazolo[4,5-c]quinolin-4-one.
What is the SMILES notation for 5-methyl-2-pentyl-[1,3]oxazolo[4,5-c]quinolin-4-one?
The canonical SMILES for 5-methyl-2-pentyl-[1,3]oxazolo[4,5-c]quinolin-4-one is CCCCCc1nc2c(=O)n(C)c3ccccc3c2o1.
What is the InChIKey of 5-methyl-2-pentyl-[1,3]oxazolo[4,5-c]quinolin-4-one?
The InChIKey is SFMYXHZHBYETOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O2/c1-3-4-5-10-13-17-14-15(20-13)11-8-6-7-9-12(11)18(2)16(14)19/h6-9H,3-5,10H2,1-2H3.
What are the key properties of 5-methyl-2-pentyl-[1,3]oxazolo[4,5-c]quinolin-4-one?
5-methyl-2-pentyl-[1,3]oxazolo[4,5-c]quinolin-4-one has a molecular weight of 270.33 g/mol, XLogP of 3.41, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-pentyl-[1,3]oxazolo[4,5-c]quinolin-4-one is sourced from PubChem (CID 3237789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).