C21H23N5O — CID 3237816
1-(4-cyanophenyl)-3-[3-(2,5,6-trimethylbenzimidazol-1-yl)propyl]urea (PubChem CID 3237816) has the molecular formula C21H23N5O and a molecular weight of 361.45 g/mol. Its IUPAC name is 1-(4-cyanophenyl)-3-[3-(2,5,6-trimethylbenzimidazol-1-yl)propyl]urea.
| Compound Name | 1-(4-cyanophenyl)-3-[3-(2,5,6-trimethylbenzimidazol-1-yl)propyl]urea |
|---|---|
| PubChem CID | 3237816 |
| Molecular Formula | C21H23N5O |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 1-(4-cyanophenyl)-3-[3-(2,5,6-trimethylbenzimidazol-1-yl)propyl]urea |
| SMILES | Cc1cc2nc(C)n(CCCNC(=O)Nc3ccc(C#N)cc3)c2cc1C |
| InChI | InChI=1S/C21H23N5O/c1-14-11-19-20(12-15(14)2)26(16(3)24-19)10-4-9-23-21(27)25-18-7-5-17(13-22)6-8-18/h5-8,11-12H,4,9-10H2,1-3H3,(H2,23,25,27) |
| InChIKey | ZTDRTJAMIZIVEX-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 82.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|