C23H27N3O3 — CID 3237832
N-[2-(3,4-dihydro-2H-quinolin-1-yl)ethyl]-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)propanamide (PubChem CID 3237832) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is N-[2-(3,4-dihydro-2H-quinolin-1-yl)ethyl]-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)propanamide.
| Compound Name | N-[2-(3,4-dihydro-2H-quinolin-1-yl)ethyl]-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)propanamide |
|---|---|
| PubChem CID | 3237832 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | N-[2-(3,4-dihydro-2H-quinolin-1-yl)ethyl]-3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)propanamide |
| SMILES | O=C(CCN1C(=O)C2C3C=CC(C3)C2C1=O)NCCN1CCCc2ccccc21 |
| InChI | InChI=1S/C23H27N3O3/c27-19(24-10-13-25-11-3-5-15-4-1-2-6-18(15)25)9-12-26-22(28)20-16-7-8-17(14-16)21(20)23(26)29/h1-2,4,6-8,16-17,20-21H,3,5,9-14H2,(H,24,27) |
| InChIKey | YNAIODWOBCUXAW-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|