C13H19NO3S3 — CID 3237887
5,5-dioxo-N-(3-propylsulfanylpropyl)-4,6-dihydrothieno[3,4-b]thiophene-2-carboxamide (PubChem CID 3237887) has the molecular formula C13H19NO3S3 and a molecular weight of 333.50 g/mol. Its IUPAC name is 5,5-dioxo-N-(3-propylsulfanylpropyl)-4,6-dihydrothieno[3,4-b]thiophene-2-carboxamide.
| Compound Name | 5,5-dioxo-N-(3-propylsulfanylpropyl)-4,6-dihydrothieno[3,4-b]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 3237887 |
| Molecular Formula | C13H19NO3S3 |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 5,5-dioxo-N-(3-propylsulfanylpropyl)-4,6-dihydrothieno[3,4-b]thiophene-2-carboxamide |
| SMILES | CCCSCCCNC(=O)c1cc2c(s1)CS(=O)(=O)C2 |
| InChI | InChI=1S/C13H19NO3S3/c1-2-5-18-6-3-4-14-13(15)11-7-10-8-20(16,17)9-12(10)19-11/h7H,2-6,8-9H2,1H3,(H,14,15) |
| InChIKey | DMPJNIVVRVDMNQ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|