C20H23FN4O2S — CID 3237977
6-(4-fluorophenyl)-3-methyl-N-(3-morpholin-4-ylpropyl)imidazo[2,1-b][1,3]thiazole-2-carboxamide (PubChem CID 3237977) has the molecular formula C20H23FN4O2S and a molecular weight of 402.50 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-3-methyl-N-(3-morpholin-4-ylpropyl)imidazo[2,1-b][1,3]thiazole-2-carboxamide.
| Compound Name | 6-(4-fluorophenyl)-3-methyl-N-(3-morpholin-4-ylpropyl)imidazo[2,1-b][1,3]thiazole-2-carboxamide |
|---|---|
| PubChem CID | 3237977 |
| Molecular Formula | C20H23FN4O2S |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 6-(4-fluorophenyl)-3-methyl-N-(3-morpholin-4-ylpropyl)imidazo[2,1-b][1,3]thiazole-2-carboxamide |
| SMILES | Cc1c(C(=O)NCCCN2CCOCC2)sc2nc(-c3ccc(F)cc3)cn12 |
| InChI | InChI=1S/C20H23FN4O2S/c1-14-18(19(26)22-7-2-8-24-9-11-27-12-10-24)28-20-23-17(13-25(14)20)15-3-5-16(21)6-4-15/h3-6,13H,2,7-12H2,1H3,(H,22,26) |
| InChIKey | CKLSSBCPOAYZCY-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|