C16H19N9S — CID 3238004
2-N,2-N-dimethyl-6-[(4-prop-2-enyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3,5-triazine-2,4-diamine (PubChem CID 3238004) has the molecular formula C16H19N9S and a molecular weight of 369.46 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-6-[(4-prop-2-enyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,2-N-dimethyl-6-[(4-prop-2-enyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 3238004 |
| Molecular Formula | C16H19N9S |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 2-N,2-N-dimethyl-6-[(4-prop-2-enyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3,5-triazine-2,4-diamine |
| SMILES | C=CCn1c(SCc2nc(N)nc(N(C)C)n2)nnc1-c1cccnc1 |
| InChI | InChI=1S/C16H19N9S/c1-4-8-25-13(11-6-5-7-18-9-11)22-23-16(25)26-10-12-19-14(17)21-15(20-12)24(2)3/h4-7,9H,1,8,10H2,2-3H3,(H2,17,19,20,21) |
| InChIKey | BYLHKERWKDNXTG-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|