About 2,4-dimethyl-N-(4-phenoxyphenyl)-1,3-oxazole-5-carboxamide
2,4-dimethyl-N-(4-phenoxyphenyl)-1,3-oxazole-5-carboxamide (PubChem CID 3238135) has the molecular formula C18H16N2O3
and a molecular weight of 308.34 g/mol. Its IUPAC name is 2,4-dimethyl-N-(4-phenoxyphenyl)-1,3-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | 2,4-dimethyl-N-(4-phenoxyphenyl)-1,3-oxazole-5-carboxamide |
| PubChem CID | 3238135 |
| Molecular Formula | C18H16N2O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 2,4-dimethyl-N-(4-phenoxyphenyl)-1,3-oxazole-5-carboxamide |
| SMILES | Cc1nc(C)c(C(=O)Nc2ccc(Oc3ccccc3)cc2)o1 |
| InChI | InChI=1S/C18H16N2O3/c1-12-17(22-13(2)19-12)18(21)20-14-8-10-16(11-9-14)23-15-6-4-3-5-7-15/h3-11H,1-2H3,(H,20,21) |
| InChIKey | BOJZANBINRRYGV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,4-dimethyl-N-(4-phenoxyphenyl)-1,3-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-N-(4-phenoxyphenyl)-1,3-oxazole-5-carboxamide?
The IUPAC name of 2,4-dimethyl-N-(4-phenoxyphenyl)-1,3-oxazole-5-carboxamide (CID 3238135) is 2,4-dimethyl-N-(4-phenoxyphenyl)-1,3-oxazole-5-carboxamide.
What is the SMILES notation for 2,4-dimethyl-N-(4-phenoxyphenyl)-1,3-oxazole-5-carboxamide?
The canonical SMILES for 2,4-dimethyl-N-(4-phenoxyphenyl)-1,3-oxazole-5-carboxamide is Cc1nc(C)c(C(=O)Nc2ccc(Oc3ccccc3)cc2)o1.
What is the InChIKey of 2,4-dimethyl-N-(4-phenoxyphenyl)-1,3-oxazole-5-carboxamide?
The InChIKey is BOJZANBINRRYGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O3/c1-12-17(22-13(2)19-12)18(21)20-14-8-10-16(11-9-14)23-15-6-4-3-5-7-15/h3-11H,1-2H3,(H,20,21).
What are the key properties of 2,4-dimethyl-N-(4-phenoxyphenyl)-1,3-oxazole-5-carboxamide?
2,4-dimethyl-N-(4-phenoxyphenyl)-1,3-oxazole-5-carboxamide has a molecular weight of 308.34 g/mol, XLogP of 4.34, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-N-(4-phenoxyphenyl)-1,3-oxazole-5-carboxamide is sourced from PubChem (CID 3238135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).