About N-(2,4-difluorophenyl)-5-(furan-2-yl)-1,2-oxazole-3-carboxamide
N-(2,4-difluorophenyl)-5-(furan-2-yl)-1,2-oxazole-3-carboxamide (PubChem CID 3238209) has the molecular formula C14H8F2N2O3
and a molecular weight of 290.23 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-5-(furan-2-yl)-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | N-(2,4-difluorophenyl)-5-(furan-2-yl)-1,2-oxazole-3-carboxamide |
| PubChem CID | 3238209 |
| Molecular Formula | C14H8F2N2O3 |
| Molecular Weight | 290.23 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | N-(2,4-difluorophenyl)-5-(furan-2-yl)-1,2-oxazole-3-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1F)c1cc(-c2ccco2)on1 |
| InChI | InChI=1S/C14H8F2N2O3/c15-8-3-4-10(9(16)6-8)17-14(19)11-7-13(21-18-11)12-2-1-5-20-12/h1-7H,(H,17,19) |
| InChIKey | NNNDKOFKRZLNMU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.23 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2,4-difluorophenyl)-5-(furan-2-yl)-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,4-difluorophenyl)-5-(furan-2-yl)-1,2-oxazole-3-carboxamide?
The IUPAC name of N-(2,4-difluorophenyl)-5-(furan-2-yl)-1,2-oxazole-3-carboxamide (CID 3238209) is N-(2,4-difluorophenyl)-5-(furan-2-yl)-1,2-oxazole-3-carboxamide.
What is the SMILES notation for N-(2,4-difluorophenyl)-5-(furan-2-yl)-1,2-oxazole-3-carboxamide?
The canonical SMILES for N-(2,4-difluorophenyl)-5-(furan-2-yl)-1,2-oxazole-3-carboxamide is O=C(Nc1ccc(F)cc1F)c1cc(-c2ccco2)on1.
What is the InChIKey of N-(2,4-difluorophenyl)-5-(furan-2-yl)-1,2-oxazole-3-carboxamide?
The InChIKey is NNNDKOFKRZLNMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8F2N2O3/c15-8-3-4-10(9(16)6-8)17-14(19)11-7-13(21-18-11)12-2-1-5-20-12/h1-7H,(H,17,19).
What are the key properties of N-(2,4-difluorophenyl)-5-(furan-2-yl)-1,2-oxazole-3-carboxamide?
N-(2,4-difluorophenyl)-5-(furan-2-yl)-1,2-oxazole-3-carboxamide has a molecular weight of 290.23 g/mol, XLogP of 3.47, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,4-difluorophenyl)-5-(furan-2-yl)-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 3238209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).