About 2,4-dimethylthieno[3,2-b]pyrrole-5-carboxylic acid
2,4-dimethylthieno[3,2-b]pyrrole-5-carboxylic acid (PubChem CID 3238235) has the molecular formula C9H9NO2S
and a molecular weight of 195.24 g/mol. Its IUPAC name is 2,4-dimethylthieno[3,2-b]pyrrole-5-carboxylic acid.
Molecular Properties
| Compound Name | 2,4-dimethylthieno[3,2-b]pyrrole-5-carboxylic acid |
| PubChem CID | 3238235 |
| Molecular Formula | C9H9NO2S |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.04 |
| IUPAC Name | 2,4-dimethylthieno[3,2-b]pyrrole-5-carboxylic acid |
| SMILES | Cc1cc2c(cc(C(=O)O)n2C)s1 |
| InChI | InChI=1S/C9H9NO2S/c1-5-3-6-8(13-5)4-7(9(11)12)10(6)2/h3-4H,1-2H3,(H,11,12) |
| InChIKey | TUBIHPRLIKRUPP-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-dimethylthieno[3,2-b]pyrrole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethylthieno[3,2-b]pyrrole-5-carboxylic acid?
The IUPAC name of 2,4-dimethylthieno[3,2-b]pyrrole-5-carboxylic acid (CID 3238235) is 2,4-dimethylthieno[3,2-b]pyrrole-5-carboxylic acid.
What is the SMILES notation for 2,4-dimethylthieno[3,2-b]pyrrole-5-carboxylic acid?
The canonical SMILES for 2,4-dimethylthieno[3,2-b]pyrrole-5-carboxylic acid is Cc1cc2c(cc(C(=O)O)n2C)s1.
What is the InChIKey of 2,4-dimethylthieno[3,2-b]pyrrole-5-carboxylic acid?
The InChIKey is TUBIHPRLIKRUPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2S/c1-5-3-6-8(13-5)4-7(9(11)12)10(6)2/h3-4H,1-2H3,(H,11,12).
What are the key properties of 2,4-dimethylthieno[3,2-b]pyrrole-5-carboxylic acid?
2,4-dimethylthieno[3,2-b]pyrrole-5-carboxylic acid has a molecular weight of 195.24 g/mol, XLogP of 2.25, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethylthieno[3,2-b]pyrrole-5-carboxylic acid is sourced from PubChem (CID 3238235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).