About 5-(4-bromophenyl)-N,N-diethyl-1,2-oxazole-3-carboxamide
5-(4-bromophenyl)-N,N-diethyl-1,2-oxazole-3-carboxamide (PubChem CID 3238274) has the molecular formula C14H15BrN2O2
and a molecular weight of 323.19 g/mol. Its IUPAC name is 5-(4-bromophenyl)-N,N-diethyl-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | 5-(4-bromophenyl)-N,N-diethyl-1,2-oxazole-3-carboxamide |
| PubChem CID | 3238274 |
| Molecular Formula | C14H15BrN2O2 |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 5-(4-bromophenyl)-N,N-diethyl-1,2-oxazole-3-carboxamide |
| SMILES | CCN(CC)C(=O)c1cc(-c2ccc(Br)cc2)on1 |
| InChI | InChI=1S/C14H15BrN2O2/c1-3-17(4-2)14(18)12-9-13(19-16-12)10-5-7-11(15)8-6-10/h5-9H,3-4H2,1-2H3 |
| InChIKey | RGPBBNVHNWQLRB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(4-bromophenyl)-N,N-diethyl-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-bromophenyl)-N,N-diethyl-1,2-oxazole-3-carboxamide?
The IUPAC name of 5-(4-bromophenyl)-N,N-diethyl-1,2-oxazole-3-carboxamide (CID 3238274) is 5-(4-bromophenyl)-N,N-diethyl-1,2-oxazole-3-carboxamide.
What is the SMILES notation for 5-(4-bromophenyl)-N,N-diethyl-1,2-oxazole-3-carboxamide?
The canonical SMILES for 5-(4-bromophenyl)-N,N-diethyl-1,2-oxazole-3-carboxamide is CCN(CC)C(=O)c1cc(-c2ccc(Br)cc2)on1.
What is the InChIKey of 5-(4-bromophenyl)-N,N-diethyl-1,2-oxazole-3-carboxamide?
The InChIKey is RGPBBNVHNWQLRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15BrN2O2/c1-3-17(4-2)14(18)12-9-13(19-16-12)10-5-7-11(15)8-6-10/h5-9H,3-4H2,1-2H3.
What are the key properties of 5-(4-bromophenyl)-N,N-diethyl-1,2-oxazole-3-carboxamide?
5-(4-bromophenyl)-N,N-diethyl-1,2-oxazole-3-carboxamide has a molecular weight of 323.19 g/mol, XLogP of 3.59, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-bromophenyl)-N,N-diethyl-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 3238274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).