About 8-fluoro-10-oxido-1,2,3,4-tetrahydrophenazin-5-ium 5-oxide
8-fluoro-10-oxido-1,2,3,4-tetrahydrophenazin-5-ium 5-oxide (PubChem CID 3238284) has the molecular formula C12H11FN2O2
and a molecular weight of 234.23 g/mol. Its IUPAC name is 8-fluoro-10-oxido-1,2,3,4-tetrahydrophenazin-5-ium 5-oxide.
Molecular Properties
| Compound Name | 8-fluoro-10-oxido-1,2,3,4-tetrahydrophenazin-5-ium 5-oxide |
| PubChem CID | 3238284 |
| Molecular Formula | C12H11FN2O2 |
| Molecular Weight | 234.23 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 8-fluoro-10-oxido-1,2,3,4-tetrahydrophenazin-5-ium 5-oxide |
| SMILES | O=[n+]1c2c(n([O-])c3cc(F)ccc31)CCCC2 |
| InChI | InChI=1S/C12H11FN2O2/c13-8-5-6-11-12(7-8)15(17)10-4-2-1-3-9(10)14(11)16/h5-7H,1-4H2 |
| InChIKey | FQHHAAKSWFXMMM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 50.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.23 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 8-fluoro-10-oxido-1,2,3,4-tetrahydrophenazin-5-ium 5-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-10-oxido-1,2,3,4-tetrahydrophenazin-5-ium 5-oxide?
The IUPAC name of 8-fluoro-10-oxido-1,2,3,4-tetrahydrophenazin-5-ium 5-oxide (CID 3238284) is 8-fluoro-10-oxido-1,2,3,4-tetrahydrophenazin-5-ium 5-oxide.
What is the SMILES notation for 8-fluoro-10-oxido-1,2,3,4-tetrahydrophenazin-5-ium 5-oxide?
The canonical SMILES for 8-fluoro-10-oxido-1,2,3,4-tetrahydrophenazin-5-ium 5-oxide is O=[n+]1c2c(n([O-])c3cc(F)ccc31)CCCC2.
What is the InChIKey of 8-fluoro-10-oxido-1,2,3,4-tetrahydrophenazin-5-ium 5-oxide?
The InChIKey is FQHHAAKSWFXMMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11FN2O2/c13-8-5-6-11-12(7-8)15(17)10-4-2-1-3-9(10)14(11)16/h5-7H,1-4H2.
What are the key properties of 8-fluoro-10-oxido-1,2,3,4-tetrahydrophenazin-5-ium 5-oxide?
8-fluoro-10-oxido-1,2,3,4-tetrahydrophenazin-5-ium 5-oxide has a molecular weight of 234.23 g/mol, XLogP of 1.92, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-10-oxido-1,2,3,4-tetrahydrophenazin-5-ium 5-oxide is sourced from PubChem (CID 3238284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).