C17H19N5O4 — CID 3238371
prop-2-enyl 7-(2,5-dimethoxyphenyl)-5-methyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 3238371) has the molecular formula C17H19N5O4 and a molecular weight of 357.37 g/mol. Its IUPAC name is prop-2-enyl 7-(2,5-dimethoxyphenyl)-5-methyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | prop-2-enyl 7-(2,5-dimethoxyphenyl)-5-methyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 3238371 |
| Molecular Formula | C17H19N5O4 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | prop-2-enyl 7-(2,5-dimethoxyphenyl)-5-methyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | C=CCOC(=O)C1=C(C)Nc2nnnn2C1c1cc(OC)ccc1OC |
| InChI | InChI=1S/C17H19N5O4/c1-5-8-26-16(23)14-10(2)18-17-19-20-21-22(17)15(14)12-9-11(24-3)6-7-13(12)25-4/h5-7,9,15H,1,8H2,2-4H3,(H,18,19,21) |
| InChIKey | YNHDZVNYFQFYPC-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|