About pyridin-3-yl-(3,4,5-trimethylpyrazol-1-yl)methanone
pyridin-3-yl-(3,4,5-trimethylpyrazol-1-yl)methanone (PubChem CID 3238427) has the molecular formula C12H13N3O
and a molecular weight of 215.26 g/mol. Its IUPAC name is pyridin-3-yl-(3,4,5-trimethylpyrazol-1-yl)methanone.
Molecular Properties
| Compound Name | pyridin-3-yl-(3,4,5-trimethylpyrazol-1-yl)methanone |
| PubChem CID | 3238427 |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | pyridin-3-yl-(3,4,5-trimethylpyrazol-1-yl)methanone |
| SMILES | Cc1nn(C(=O)c2cccnc2)c(C)c1C |
| InChI | InChI=1S/C12H13N3O/c1-8-9(2)14-15(10(8)3)12(16)11-5-4-6-13-7-11/h4-7H,1-3H3 |
| InChIKey | OEYQWHLWLLHMMA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyridin-3-yl-(3,4,5-trimethylpyrazol-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-3-yl-(3,4,5-trimethylpyrazol-1-yl)methanone?
The IUPAC name of pyridin-3-yl-(3,4,5-trimethylpyrazol-1-yl)methanone (CID 3238427) is pyridin-3-yl-(3,4,5-trimethylpyrazol-1-yl)methanone.
What is the SMILES notation for pyridin-3-yl-(3,4,5-trimethylpyrazol-1-yl)methanone?
The canonical SMILES for pyridin-3-yl-(3,4,5-trimethylpyrazol-1-yl)methanone is Cc1nn(C(=O)c2cccnc2)c(C)c1C.
What is the InChIKey of pyridin-3-yl-(3,4,5-trimethylpyrazol-1-yl)methanone?
The InChIKey is OEYQWHLWLLHMMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O/c1-8-9(2)14-15(10(8)3)12(16)11-5-4-6-13-7-11/h4-7H,1-3H3.
What are the key properties of pyridin-3-yl-(3,4,5-trimethylpyrazol-1-yl)methanone?
pyridin-3-yl-(3,4,5-trimethylpyrazol-1-yl)methanone has a molecular weight of 215.26 g/mol, XLogP of 1.89, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-3-yl-(3,4,5-trimethylpyrazol-1-yl)methanone is sourced from PubChem (CID 3238427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).