About 6-pyrrolidin-1-yl-2,3-dihydrophthalazine-1,4-dione
6-pyrrolidin-1-yl-2,3-dihydrophthalazine-1,4-dione (PubChem CID 3238441) has the molecular formula C12H13N3O2
and a molecular weight of 231.25 g/mol. Its IUPAC name is 6-pyrrolidin-1-yl-2,3-dihydrophthalazine-1,4-dione.
Molecular Properties
| Compound Name | 6-pyrrolidin-1-yl-2,3-dihydrophthalazine-1,4-dione |
| PubChem CID | 3238441 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 6-pyrrolidin-1-yl-2,3-dihydrophthalazine-1,4-dione |
| SMILES | O=c1[nH][nH]c(=O)c2cc(N3CCCC3)ccc12 |
| InChI | InChI=1S/C12H13N3O2/c16-11-9-4-3-8(15-5-1-2-6-15)7-10(9)12(17)14-13-11/h3-4,7H,1-2,5-6H2,(H,13,16)(H,14,17) |
| InChIKey | XSPRIKTXDGPZDW-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 68.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-pyrrolidin-1-yl-2,3-dihydrophthalazine-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-pyrrolidin-1-yl-2,3-dihydrophthalazine-1,4-dione?
The IUPAC name of 6-pyrrolidin-1-yl-2,3-dihydrophthalazine-1,4-dione (CID 3238441) is 6-pyrrolidin-1-yl-2,3-dihydrophthalazine-1,4-dione.
What is the SMILES notation for 6-pyrrolidin-1-yl-2,3-dihydrophthalazine-1,4-dione?
The canonical SMILES for 6-pyrrolidin-1-yl-2,3-dihydrophthalazine-1,4-dione is O=c1[nH][nH]c(=O)c2cc(N3CCCC3)ccc12.
What is the InChIKey of 6-pyrrolidin-1-yl-2,3-dihydrophthalazine-1,4-dione?
The InChIKey is XSPRIKTXDGPZDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O2/c16-11-9-4-3-8(15-5-1-2-6-15)7-10(9)12(17)14-13-11/h3-4,7H,1-2,5-6H2,(H,13,16)(H,14,17).
What are the key properties of 6-pyrrolidin-1-yl-2,3-dihydrophthalazine-1,4-dione?
6-pyrrolidin-1-yl-2,3-dihydrophthalazine-1,4-dione has a molecular weight of 231.25 g/mol, XLogP of 0.82, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-pyrrolidin-1-yl-2,3-dihydrophthalazine-1,4-dione is sourced from PubChem (CID 3238441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).