About 6-hydroxy-6aH-isoindolo[2,3-a]quinazoline-5,11-dione
6-hydroxy-6aH-isoindolo[2,3-a]quinazoline-5,11-dione (PubChem CID 3238645) has the molecular formula C15H10N2O3
and a molecular weight of 266.26 g/mol. Its IUPAC name is 6-hydroxy-6aH-isoindolo[2,3-a]quinazoline-5,11-dione.
Molecular Properties
| Compound Name | 6-hydroxy-6aH-isoindolo[2,3-a]quinazoline-5,11-dione |
| PubChem CID | 3238645 |
| Molecular Formula | C15H10N2O3 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 6-hydroxy-6aH-isoindolo[2,3-a]quinazoline-5,11-dione |
| SMILES | O=C1c2ccccc2N2C(=O)c3ccccc3C2N1O |
| InChI | InChI=1S/C15H10N2O3/c18-14-10-6-2-1-5-9(10)13-16(14)12-8-4-3-7-11(12)15(19)17(13)20/h1-8,13,20H |
| InChIKey | CMQQFBSFQVDHII-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|
Analyze 6-hydroxy-6aH-isoindolo[2,3-a]quinazoline-5,11-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-6aH-isoindolo[2,3-a]quinazoline-5,11-dione?
The IUPAC name of 6-hydroxy-6aH-isoindolo[2,3-a]quinazoline-5,11-dione (CID 3238645) is 6-hydroxy-6aH-isoindolo[2,3-a]quinazoline-5,11-dione.
What is the SMILES notation for 6-hydroxy-6aH-isoindolo[2,3-a]quinazoline-5,11-dione?
The canonical SMILES for 6-hydroxy-6aH-isoindolo[2,3-a]quinazoline-5,11-dione is O=C1c2ccccc2N2C(=O)c3ccccc3C2N1O.
What is the InChIKey of 6-hydroxy-6aH-isoindolo[2,3-a]quinazoline-5,11-dione?
The InChIKey is CMQQFBSFQVDHII-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N2O3/c18-14-10-6-2-1-5-9(10)13-16(14)12-8-4-3-7-11(12)15(19)17(13)20/h1-8,13,20H.
What are the key properties of 6-hydroxy-6aH-isoindolo[2,3-a]quinazoline-5,11-dione?
6-hydroxy-6aH-isoindolo[2,3-a]quinazoline-5,11-dione has a molecular weight of 266.26 g/mol, XLogP of 2.19, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-6aH-isoindolo[2,3-a]quinazoline-5,11-dione is sourced from PubChem (CID 3238645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).