C22H34N4O3S — CID 3238713
N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-1-pyrrolidin-1-ylsulfonylpiperidine-4-carboxamide (PubChem CID 3238713) has the molecular formula C22H34N4O3S and a molecular weight of 434.61 g/mol. Its IUPAC name is N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-1-pyrrolidin-1-ylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-1-pyrrolidin-1-ylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 3238713 |
| Molecular Formula | C22H34N4O3S |
| Molecular Weight | 434.61 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-1-pyrrolidin-1-ylsulfonylpiperidine-4-carboxamide |
| SMILES | O=C(NCCCN1CCc2ccccc2C1)C1CCN(S(=O)(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C22H34N4O3S/c27-22(20-9-16-26(17-10-20)30(28,29)25-13-3-4-14-25)23-11-5-12-24-15-8-19-6-1-2-7-21(19)18-24/h1-2,6-7,20H,3-5,8-18H2,(H,23,27) |
| InChIKey | IGKKASDDYVNLHM-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.61 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|