About 4-(3-methoxyphenyl)-2-(1,2,4-triazol-1-yl)-6-(trifluoromethyl)pyrimidine
4-(3-methoxyphenyl)-2-(1,2,4-triazol-1-yl)-6-(trifluoromethyl)pyrimidine (PubChem CID 3238820) has the molecular formula C14H10F3N5O
and a molecular weight of 321.26 g/mol. Its IUPAC name is 4-(3-methoxyphenyl)-2-(1,2,4-triazol-1-yl)-6-(trifluoromethyl)pyrimidine.
Molecular Properties
| Compound Name | 4-(3-methoxyphenyl)-2-(1,2,4-triazol-1-yl)-6-(trifluoromethyl)pyrimidine |
| PubChem CID | 3238820 |
| Molecular Formula | C14H10F3N5O |
| Molecular Weight | 321.26 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 4-(3-methoxyphenyl)-2-(1,2,4-triazol-1-yl)-6-(trifluoromethyl)pyrimidine |
| SMILES | COc1cccc(-c2cc(C(F)(F)F)nc(-n3cncn3)n2)c1 |
| InChI | InChI=1S/C14H10F3N5O/c1-23-10-4-2-3-9(5-10)11-6-12(14(15,16)17)21-13(20-11)22-8-18-7-19-22/h2-8H,1H3 |
| InChIKey | UOJNPPIBMFRDNJ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.26 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(3-methoxyphenyl)-2-(1,2,4-triazol-1-yl)-6-(trifluoromethyl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-methoxyphenyl)-2-(1,2,4-triazol-1-yl)-6-(trifluoromethyl)pyrimidine?
The IUPAC name of 4-(3-methoxyphenyl)-2-(1,2,4-triazol-1-yl)-6-(trifluoromethyl)pyrimidine (CID 3238820) is 4-(3-methoxyphenyl)-2-(1,2,4-triazol-1-yl)-6-(trifluoromethyl)pyrimidine.
What is the SMILES notation for 4-(3-methoxyphenyl)-2-(1,2,4-triazol-1-yl)-6-(trifluoromethyl)pyrimidine?
The canonical SMILES for 4-(3-methoxyphenyl)-2-(1,2,4-triazol-1-yl)-6-(trifluoromethyl)pyrimidine is COc1cccc(-c2cc(C(F)(F)F)nc(-n3cncn3)n2)c1.
What is the InChIKey of 4-(3-methoxyphenyl)-2-(1,2,4-triazol-1-yl)-6-(trifluoromethyl)pyrimidine?
The InChIKey is UOJNPPIBMFRDNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10F3N5O/c1-23-10-4-2-3-9(5-10)11-6-12(14(15,16)17)21-13(20-11)22-8-18-7-19-22/h2-8H,1H3.
What are the key properties of 4-(3-methoxyphenyl)-2-(1,2,4-triazol-1-yl)-6-(trifluoromethyl)pyrimidine?
4-(3-methoxyphenyl)-2-(1,2,4-triazol-1-yl)-6-(trifluoromethyl)pyrimidine has a molecular weight of 321.26 g/mol, XLogP of 2.75, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-methoxyphenyl)-2-(1,2,4-triazol-1-yl)-6-(trifluoromethyl)pyrimidine is sourced from PubChem (CID 3238820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).