About [2-[1-(2,4-dioxopyrimidin-1-yl)-2-hydroxyethoxy]-3-hydroxypropyl] benzoate
[2-[1-(2,4-dioxopyrimidin-1-yl)-2-hydroxyethoxy]-3-hydroxypropyl] benzoate (PubChem CID 3238902) has the molecular formula C16H18N2O7
and a molecular weight of 350.33 g/mol. Its IUPAC name is [2-[1-(2,4-dioxopyrimidin-1-yl)-2-hydroxyethoxy]-3-hydroxypropyl] benzoate.
Molecular Properties
| Compound Name | [2-[1-(2,4-dioxopyrimidin-1-yl)-2-hydroxyethoxy]-3-hydroxypropyl] benzoate |
| PubChem CID | 3238902 |
| Molecular Formula | C16H18N2O7 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | [2-[1-(2,4-dioxopyrimidin-1-yl)-2-hydroxyethoxy]-3-hydroxypropyl] benzoate |
| SMILES | O=C(OCC(CO)OC(CO)n1ccc(=O)[nH]c1=O)c1ccccc1 |
| InChI | InChI=1S/C16H18N2O7/c19-8-12(10-24-15(22)11-4-2-1-3-5-11)25-14(9-20)18-7-6-13(21)17-16(18)23/h1-7,12,14,19-20H,8-10H2,(H,17,21,23) |
| InChIKey | HDTLWCVZHVXBGX-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 130.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [2-[1-(2,4-dioxopyrimidin-1-yl)-2-hydroxyethoxy]-3-hydroxypropyl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[1-(2,4-dioxopyrimidin-1-yl)-2-hydroxyethoxy]-3-hydroxypropyl] benzoate?
The IUPAC name of [2-[1-(2,4-dioxopyrimidin-1-yl)-2-hydroxyethoxy]-3-hydroxypropyl] benzoate (CID 3238902) is [2-[1-(2,4-dioxopyrimidin-1-yl)-2-hydroxyethoxy]-3-hydroxypropyl] benzoate.
What is the SMILES notation for [2-[1-(2,4-dioxopyrimidin-1-yl)-2-hydroxyethoxy]-3-hydroxypropyl] benzoate?
The canonical SMILES for [2-[1-(2,4-dioxopyrimidin-1-yl)-2-hydroxyethoxy]-3-hydroxypropyl] benzoate is O=C(OCC(CO)OC(CO)n1ccc(=O)[nH]c1=O)c1ccccc1.
What is the InChIKey of [2-[1-(2,4-dioxopyrimidin-1-yl)-2-hydroxyethoxy]-3-hydroxypropyl] benzoate?
The InChIKey is HDTLWCVZHVXBGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O7/c19-8-12(10-24-15(22)11-4-2-1-3-5-11)25-14(9-20)18-7-6-13(21)17-16(18)23/h1-7,12,14,19-20H,8-10H2,(H,17,21,23).
What are the key properties of [2-[1-(2,4-dioxopyrimidin-1-yl)-2-hydroxyethoxy]-3-hydroxypropyl] benzoate?
[2-[1-(2,4-dioxopyrimidin-1-yl)-2-hydroxyethoxy]-3-hydroxypropyl] benzoate has a molecular weight of 350.33 g/mol, XLogP of -0.74, 8 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[1-(2,4-dioxopyrimidin-1-yl)-2-hydroxyethoxy]-3-hydroxypropyl] benzoate is sourced from PubChem (CID 3238902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).