C19H20N4O3 — CID 3238932
N-(3-imidazol-1-ylpropyl)-7-methoxy-4,5-dihydrobenzo[g][1,2]benzoxazole-3-carboxamide (PubChem CID 3238932) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-7-methoxy-4,5-dihydrobenzo[g][1,2]benzoxazole-3-carboxamide.
| Compound Name | N-(3-imidazol-1-ylpropyl)-7-methoxy-4,5-dihydrobenzo[g][1,2]benzoxazole-3-carboxamide |
|---|---|
| PubChem CID | 3238932 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-7-methoxy-4,5-dihydrobenzo[g][1,2]benzoxazole-3-carboxamide |
| SMILES | COc1ccc2c(c1)CCc1c(C(=O)NCCCn3ccnc3)noc1-2 |
| InChI | InChI=1S/C19H20N4O3/c1-25-14-4-6-15-13(11-14)3-5-16-17(22-26-18(15)16)19(24)21-7-2-9-23-10-8-20-12-23/h4,6,8,10-12H,2-3,5,7,9H2,1H3,(H,21,24) |
| InChIKey | XCFRVASMUIEGJM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|