C23H25N5O4 — CID 3238938
1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-[1-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)ethyl]urea (PubChem CID 3238938) has the molecular formula C23H25N5O4 and a molecular weight of 435.48 g/mol. Its IUPAC name is 1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-[1-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)ethyl]urea.
| Compound Name | 1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-[1-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)ethyl]urea |
|---|---|
| PubChem CID | 3238938 |
| Molecular Formula | C23H25N5O4 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | 1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-[1-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)ethyl]urea |
| SMILES | Cc1c(NC(=O)NC(C)N2C(=O)C3C4C=CC(C4)C3C2=O)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C23H25N5O4/c1-12-19(22(31)28(26(12)3)16-7-5-4-6-8-16)25-23(32)24-13(2)27-20(29)17-14-9-10-15(11-14)18(17)21(27)30/h4-10,13-15,17-18H,11H2,1-3H3,(H2,24,25,32) |
| InChIKey | YRFMEBFPGYEBAL-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|