About 5-(1,3-benzodioxol-5-yl)-N-(5-methyl-2-phenylpyrazol-3-yl)-1,2-oxazole-3-carboxamide
5-(1,3-benzodioxol-5-yl)-N-(5-methyl-2-phenylpyrazol-3-yl)-1,2-oxazole-3-carboxamide (PubChem CID 3239065) has the molecular formula C21H16N4O4
and a molecular weight of 388.38 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-N-(5-methyl-2-phenylpyrazol-3-yl)-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | 5-(1,3-benzodioxol-5-yl)-N-(5-methyl-2-phenylpyrazol-3-yl)-1,2-oxazole-3-carboxamide |
| PubChem CID | 3239065 |
| Molecular Formula | C21H16N4O4 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-N-(5-methyl-2-phenylpyrazol-3-yl)-1,2-oxazole-3-carboxamide |
| SMILES | Cc1cc(NC(=O)c2cc(-c3ccc4c(c3)OCO4)on2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C21H16N4O4/c1-13-9-20(25(23-13)15-5-3-2-4-6-15)22-21(26)16-11-18(29-24-16)14-7-8-17-19(10-14)28-12-27-17/h2-11H,12H2,1H3,(H,22,26) |
| InChIKey | CUHDHHALNPPZAQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-(1,3-benzodioxol-5-yl)-N-(5-methyl-2-phenylpyrazol-3-yl)-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,3-benzodioxol-5-yl)-N-(5-methyl-2-phenylpyrazol-3-yl)-1,2-oxazole-3-carboxamide?
The IUPAC name of 5-(1,3-benzodioxol-5-yl)-N-(5-methyl-2-phenylpyrazol-3-yl)-1,2-oxazole-3-carboxamide (CID 3239065) is 5-(1,3-benzodioxol-5-yl)-N-(5-methyl-2-phenylpyrazol-3-yl)-1,2-oxazole-3-carboxamide.
What is the SMILES notation for 5-(1,3-benzodioxol-5-yl)-N-(5-methyl-2-phenylpyrazol-3-yl)-1,2-oxazole-3-carboxamide?
The canonical SMILES for 5-(1,3-benzodioxol-5-yl)-N-(5-methyl-2-phenylpyrazol-3-yl)-1,2-oxazole-3-carboxamide is Cc1cc(NC(=O)c2cc(-c3ccc4c(c3)OCO4)on2)n(-c2ccccc2)n1.
What is the InChIKey of 5-(1,3-benzodioxol-5-yl)-N-(5-methyl-2-phenylpyrazol-3-yl)-1,2-oxazole-3-carboxamide?
The InChIKey is CUHDHHALNPPZAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16N4O4/c1-13-9-20(25(23-13)15-5-3-2-4-6-15)22-21(26)16-11-18(29-24-16)14-7-8-17-19(10-14)28-12-27-17/h2-11H,12H2,1H3,(H,22,26).
What are the key properties of 5-(1,3-benzodioxol-5-yl)-N-(5-methyl-2-phenylpyrazol-3-yl)-1,2-oxazole-3-carboxamide?
5-(1,3-benzodioxol-5-yl)-N-(5-methyl-2-phenylpyrazol-3-yl)-1,2-oxazole-3-carboxamide has a molecular weight of 388.38 g/mol, XLogP of 3.82, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,3-benzodioxol-5-yl)-N-(5-methyl-2-phenylpyrazol-3-yl)-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 3239065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).